
CAS Number5460-63-9
Synonymsmethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate; 2,2-dimethyl-3-(2-methylprop-1-enyl)-1-cyclopropanecarboxylic acid methyl ester; 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylic acid methyl ester; Cyclopropanecarboxylic acid, 2-2-dimethyl-3-(2-methyl-1-propenyl)-, methyl ester, trans-; AI3-30968
Molecular FormulaC11H18O2
Molecular Weight302.41
Purity98.00%%
EINECS209-542-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5460-63-9 |
| Catalog No. | 2A-4188243 |
| Chinese Name | 菊酸甲酯 |
| Synonyms | methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate; 2,2-dimethyl-3-(2-methylprop-1-enyl)-1-cyclopropanecarboxylic acid methyl ester; 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylic acid methyl ester; Cyclopropanecarboxylic acid, 2-2-dimethyl-3-(2-methyl-1-propenyl)-, methyl ester, trans-; AI3-30968 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 302.41 |
| Purity | 98.00% |
| EINECS | 209-542-4 |
| HTC | 2916209090 |
| PubChem ID | 329754485 |
| MDL Number | MFCD00045443 |
| SMILES | COC(=O)C1C(C=C(C)C)C1(C)C |
| InChI | InChI=1S/C11H18O2/c1-7(2)6-8-9(10(12)13-5)11(8,3)4/h6,8-9H,1-5H3 |
| InChI Key | ITNHSNMLIFFVQC-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Pactamycin | 23668-11-3 | 2A-2188237 |
| Olivomycin | 11006-70-5 | 2A-2188238 |
| Duocarmycin A | 118292-34-5 | 2A-2188239 |
| ANSAMITOCIN DERIV | 72902-38-6 | 2A-2188241 |
| Ethylenediamine Tetra (Methylene Phosphonic Acid) Calcium Sodium Salt | 138314-12-2 | 2A-1188181 |
| Rotigotine-O-thienylethyl | 1422357-33-2 | 2A-1188244 |
| Ethyl Rotigotine | 1369625-04-6 | 2A-1188245 |
| Ethyl Rotigotine HCl | 1369532-05-7 | 2A-1188246 |
| O-Acetyl Rotigotine HCl | 1229620-82-9 | 2A-1188247 |
| jolkinolide B | 37905-08-1 | 2A-1188248 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA