
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62949-76-2 |
| Catalog No. | 2A-2188213 |
| Chinese Name | Xanthoangelol |
| Synonyms | Xanthoangelol; xanthoangerol; 2',4,4'-trihydroxy-3'-geranylchalcone; 3-geranyl-2,4,4'-trihydroxychalcone |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.49 |
| Density | 1.165g/cm3 |
| Boiling Point | 605.8ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Xanthoangelol can be isolated from Angelica keiskei and can inhibit the inflammatory response caused by obesity. Xanthoangelol has antimicrobial activity. Xanthoangelol inhibits monoamine oxidase. Xan |
| PubChem ID | 813067 |
| MDL Number | MFCD17167046 |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)ccc(C(=O)C=Cc2ccc(O)cc2)c1O |
| InChI | InChI=1S/C25H28O4/c1-17(2)5-4-6-18(3)7-13-21-24(28)16-14-22(25(21)29)23(27)15-10-19-8-11-20(26)12-9-19/h5,7-12,14-16,26,28-29H,4,6,13H2,1-3H3/b15-10+,18-7+ |
| InChI Key | LRSMBOSQWGHYCW-MDGZPELGSA-N |
| Transport Info | Product name: Xanthoangelol |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Megalomicin | 129428-69-9 | 2A-2188207 |
| Tylosin, 3-acetate 4B-(3-methylbutanoate) | 63409-12-1 | 2A-2188208 |
| 5-O-methyllicoricidin | 129314-37-0 | 2A-2188209 |
| Glyasperin D | 142561-10-2 | 2A-2188210 |
| GRAMICIDIN C | 113-73-5 | 2A-2188212 |
| Lonicerin | 25694-72-8 | 2A-2188214 |
| Pseudouridimycin (PUM) | 1566586-52-4 | 2A-2188215 |
| ANTIBIOTIC MYC-8003 | 50935-71-2 | 2A-2188216 |
| balhimycin | 140932-79-2 | 2A-2188217 |
| subtilosin A | 98914-01-3 | 2A-2188218 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA