
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 138564-16-6 |
| Catalog No. | 2A-9001895 |
| Chinese Name | 2,4-二氟-N-甲基苯胺 |
| Synonyms | 2,4-difluoro-N-methylaniline; 2,4-difluoro-N-methyl-aniline; (2,4-difluorophenyl)-methyl-amine; ZINC00167002; TL 00100 |
| Molecular Formula | C7H7N1F2 |
| Molecular Weight | 143.14 |
| Purity | 98 |
| Density | 1.22g/cm3 |
| Boiling Point | 94-96°C 15mm |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2921420090 |
| MDL Number | MFCD00042472 |
| SMILES | CNc1ccc(F)cc1F |
| InChI | InChI=1S/C7H7F2N/c1-10-7-3-2-5(8)4-6(7)9/h2-4,10H,1H3 |
| InChI Key | RPGDVPAENGWKAO-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/1895_1_138564_16_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Difluorochlorobenzene | 1435-44-5 | 2A-9001890 |
| 2,4-Difluorocinnamic acid | 774-73-2 | 2A-9001891 |
| 2,4-Difluoro-DL-phenylalanine | 32133-35-0 | 2A-9001892 |
| 2,4-Difluoroiodobenzene | 2265-93-2 | 2A-9001893 |
| 2,4-Difluoromandelic acid | 132741-30-1 | 2A-9001894 |
| 2,4-Difluorophenacyl chloride | 51336-94-8 | 2A-9001896 |
| 2,4-Difluorophenol | 367-27-1 | 2A-9001897 |
| 2,4-Difluorophenyl isocyanate | 59025-55-7 | 2A-9001898 |
| 2,4-Difluorophenylacetic acid | 81228-09-3 | 2A-9001899 |
| 2,4-Difluorophenylacetonitrile | 656-35-9 | 2A-9001900 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA