
CAS Number60660-75-5
SynonymsBestatin,Ubenimex; (7S,9S)-9-Acetyl-6,7,9,11-tetrahydroxy-7,8,9,10-tetrahydro-5,12-tetracenedione; NK 421; [(2s,3r)-3-amino-2-hydroxy-4-phenylbutanoyl]-l-leucine; Bestatin; Ubenimexum [Latin]; EINECS 261-529-2
Molecular FormulaC20H16O7
Molecular Weight368.34
Density1.6±0.1 g/cm3
Boiling Point625.6±55.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60660-75-5 |
| Catalog No. | 2A-2187979 |
| Chinese Name | 伊达比星酮 |
| Synonyms | Bestatin,Ubenimex; (7S,9S)-9-Acetyl-6,7,9,11-tetrahydroxy-7,8,9,10-tetrahydro-5,12-tetracenedione; NK 421; [(2s,3r)-3-amino-2-hydroxy-4-phenylbutanoyl]-l-leucine; Bestatin; Ubenimexum [Latin]; EINECS 261-529-2 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 625.6±55.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| PubChem ID | 10241159 |
| MDL Number | MFCD09952466 |
| SMILES | CC(=O)C1(O)Cc2c(O)c3c(c(O)c2C(O)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C20H16O7/c1-8(21)20(27)6-11-13(12(22)7-20)19(26)15-14(18(11)25)16(23)9-4-2-3-5-10(9)17(15)24/h2-5,12,22,25-27H,6-7H2,1H3/t12-,20-/m0/s1 |
| InChI Key | ZUFQFGSMHXKORU-YUNKPMOVSA-N |
| Transport Info | Product name: (7S, 9S) 9-acetyl-7,8,9,10-tetrahydro-6,7,9,11-tetrahydroxy-5,12-tetracenedione |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DMAC-BP | 1685287-55-1 | 2A-2187974 |
| Meisoindigo | 97207-47-1 | 2A-2187976 |
| D-GLUCOHEPTONO-1,4-LACTONE | 60046-25-5 | 2A-4187977 |
| Sitagliptan | 790712-60-6 | 2A-1187928 |
| PANTETHINE | 138148-35-3 | 2A-2187978 |
| L-DaunosamineHCl | 19196-51-1 | 2A-2187980 |
| DAUNOSAMINE HYDROCHLORIDE | 32385-06-1 | 2A-2187981 |
| derivate of DaunosaMine | 208942-26-1 | 2A-2187982 |
| derivate of DaunosaMine | 177650-91-8 | 2A-2187983 |
| N-Trifluoroacetamido-1,4-di-p-nitrobenzoyl Daunosamine | 52583-22-9 | 2A-2187984 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA