
CAS Number7721-62-2
Synonyms6-methylveratraldehyde; 2-Methyl-4,5-dimethoxybenzaldehyde; 2-Methyl-4,5-dimethoxybenzaldehyd; 4,5-Dimethoxy-2-methyl-benzaldehyd; 4,5-dimethoxy-2-methyl-benzaldehyde
Molecular FormulaC10H12O3
Molecular Weight180.2
Density1.089g/cm3
Boiling Point298.4ºC at 760 mmHg
Melting Point86-87 °C
AppearanceOff-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7721-62-2 |
| Catalog No. | 2A-2187923 |
| Chinese Name | 4,5-二甲氧基-2-甲基苯甲醛 |
| Synonyms | 6-methylveratraldehyde; 2-Methyl-4,5-dimethoxybenzaldehyde; 2-Methyl-4,5-dimethoxybenzaldehyd; 4,5-Dimethoxy-2-methyl-benzaldehyd; 4,5-dimethoxy-2-methyl-benzaldehyde |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Density | 1.089g/cm3 |
| Boiling Point | 298.4ºC at 760 mmHg |
| Melting Point | 86-87 °C |
| Appearance | Off-white solid |
| Storage Condition | 2-8°C, inert atmosphere |
| HTC | 2912499000 |
| PubChem ID | 408525 |
| SMILES | COc1cc(C)c(C=O)cc1OC |
| InChI | InChI=1S/C10H12O3/c1-7-4-9(12-2)10(13-3)5-8(7)6-11/h4-6H,1-3H3 |
| InChI Key | RMIZEUOAFVZZJG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-chlorocyclopropane-1-carboxylic acid | 108817-35-2 | 2A-2187860 |
| 4,4,5,5-TetraMethyl-2-(oxetan-3-yl)-1,3,2-dioxaborolane | 1396215-84-1 | 2A-2187864 |
| 1-(Oxetan-3-yl)-3-(4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea | 1260088-68-3 | 2A-2187868 |
| (1E)-D-Glucose hydrazone | 190259-02-0 | 2A-2187876 |
| BENZALDEHYDE, 3-METHOXY-4-[(2,3,4,6-TETRA-O-ACETYLHEXOPYRANOSYL)OXY]- | 51482-43-0 | 2A-2187907 |
| 2,2'-(2,5-bis(trifluoromethyl)-1,4-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) | 1073339-16-8 | 2A-2187946 |
| 1,4-bis(trifluoromethyl)-2,5-dibromobenzene | 2375-96-4 | 2A-2187947 |
| 2,2'-(2,5-dihexyl-1,4-phenylene)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) | 374934-77-7 | 2A-2187948 |
| 4-(9,9-Dimethyl-9,10-dihydroacridine)phenylboronic acid | 1246021-61-3 | 2A-2187964 |
| 10-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10H-phenoxazine | 1647121-47-8 | 2A-2187971 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA