
CAS Number115-25-3
SynonymsCyclooctafluorobutane; Cyclobutane,octafluoro; Propellant C318; Freon C-318; octafluoro-cyclobutane; Octafluor-cyclobutan; Halocarbon C-138; PERFLUOROCYCLOBUTANE; EINECS 204-075-2; MFCD00040334
Molecular FormulaC4F8
Molecular Weight200.03000
Purity98.00%
Density1,48 g/cm3
Boiling Point-6 °C
Melting Point-41.4 °C
AppearanceColorless gas with an air-like odor
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115-25-3 |
| Catalog No. | 2A-9018923 |
| Chinese Name | 八氟环丁烷 |
| Synonyms | Cyclooctafluorobutane; Cyclobutane,octafluoro; Propellant C318; Freon C-318; octafluoro-cyclobutane; Octafluor-cyclobutan; Halocarbon C-138; PERFLUOROCYCLOBUTANE; EINECS 204-075-2; MFCD00040334 |
| Molecular Formula | C4F8 |
| Molecular Weight | 200.03000 |
| Purity | 98.00 |
| Density | 1,48 g/cm3 |
| Boiling Point | -6 °C |
| Melting Point | -41.4 °C |
| Appearance | Colorless gas with an air-like odor |
| Storage Condition | The warehouse is ventilated, low-temperature and d |
| Packaging | Ⅲ |
| HTC | 2903890090 |
| SMILES | FC1(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F8/c5-1(6)2(7,8)4(11,12)3(1,9)10 |
| InChI Key | BCCOBQSFUDVTJQ-UHFFFAOYSA-N |
| Hazard Symbols | 2.2 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Thioformamide | 115-08-2 | 2A-9018914 |
| Dimethyl ether | 115-10-6 | 2A-9018915 |
| 2-Methyl-3-buten-2-ol | 115-18-4 | 2A-9018918 |
| 3-Methyl butynol | 115-19-5 | 2A-9018919 |
| 3-Hydroxy-3-methyl-2-butanone | 115-22-0 | 2A-9018922 |
| Chlorendic anhydride | 115-27-5 | 2A-9018924 |
| Chlorendic acid | 115-28-6 | 2A-9018925 |
| Bromophenol Blue | 115-39-9 | 2A-9018928 |
| Bromocresol Purple | 115-40-2 | 2A-9018929 |
| Pyrocatechol Violet | 115-41-3 | 2A-9018930 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA