
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 63141-09-3 |
| Catalog No. | 2A-2187859 |
| Chinese Name | 1-(1-氯环丙基)乙酮 |
| Synonyms | 1-Acetyl-1-chlor-cyclopropan; 1-acetyl-1-chloro-cyclopropane; 1-chlorocyclopropyl methyl ketone |
| Molecular Formula | C5H7ClO |
| Molecular Weight | 118.56 |
| Density | 1.16g/cm3 |
| Boiling Point | 150.3ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 24842397 |
| SMILES | CC(=O)C1(Cl)CC1 |
| InChI | InChI=1S/C5H7ClO/c1-4(7)5(6)2-3-5/h2-3H2,1H3 |
| InChI Key | KADOHHPNWMXGNG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| trans-2-fluorocyclopropanamine 4-methylbenzenesulfonate | 1799439-05-6 | 2A-2187848 |
| 1-cyclopropyl-2-methoxyethanamine hydrochloride | 1095431-18-7 | 2A-2187849 |
| Trans-2-fluorocyclopropanamine hydrochloride | 114152-96-4 | 2A-2187850 |
| 1-(2-Chlorophenyl)cyclopropanaMine hydrochloride | 1134699-45-8 | 2A-2187856 |
| 2-MethylcyclopropanecarboxaMide | 81428-99-1 | 2A-2187857 |
| 1-chloroCyclopropanepropanoic acid | 681128-31-4 | 2A-2187861 |
| 1-(oxetan-3-ylidene)propan-2-one | 1221819-47-1 | 2A-2187863 |
| N-Methyl-N-(oxetan-3-yl)azetidin-3-aMine dihydrochloride | 1403767-34-9 | 2A-2187867 |
| Oxetan-3-aMine oxalate | 1193389-20-6 | 2A-2187870 |
| 2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOPYRANOSYLAMINE | 51642-81-0 | 2A-2187872 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA