
CAS Number58749-23-8
Synonyms2-methoxy-3,4,4'-trihydroxychalcone; Licochalcone B; Licochalcon B; (2E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one; licochalcone
Molecular FormulaC16H14O5
Molecular Weight286.28
Density1.4±0.1 g/cm3
Boiling Point550.5±50.0 °C at 760 mmHg
Melting Point196-197ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58749-23-8 |
| Catalog No. | 2A-2187739 |
| Chinese Name | 甘草查尔酮B |
| Synonyms | 2-methoxy-3,4,4'-trihydroxychalcone; Licochalcone B; Licochalcon B; (2E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one; licochalcone |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 550.5±50.0 °C at 760 mmHg |
| Melting Point | 196-197ºC |
| Storage Condition | 2-8C |
| Application | Licochalcone B is extracted from the root of Glycyrrhiza inflate. Licochalcone B inhibits amyloid β (Aβ420) self-aggregation (IC50=2.16 μM) and disintegrates preformed Aβ42 fibrils, reducing metal-ind |
| PubChem ID | 638995 |
| MDL Number | MFCD20527294 |
| SMILES | COc1c(C=CC(=O)c2ccc(O)cc2)ccc(O)c1O |
| InChI | InChI=1S/C16H14O5/c1-21-16-11(5-9-14(19)15(16)20)4-8-13(18)10-2-6-12(17)7-3-10/h2-9,17,19-20H,1H3/b8-4+ |
| InChI Key | DRDRYGIIYOPBBZ-XBXARRHUSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352205 |
| Transport Info | Product name: Licochalcone B |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| β-D-Glucopyranoside, 4-[(1E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl | 38967-99-6 | 2A-2187622 |
| ERIODICTIOL-7-GLUCOSIDE | 31712-49-9 | 2A-2187639 |
| NARINGENIN-7-O-GLUCOSIDE | 529-55-5 | 2A-2187640 |
| NOTOPTEROL | 88206-46-6 | 2A-1187737 |
| ISOLIQUIRITIN | 5041-81-6 | 2A-2187738 |
| LICOCHALCONEC | 144506-14-9 | 2A-2187740 |
| β-D-Glucopyranoside,(3β,6α,16β,20R,24S)-3-[(3,4-di-O-acetyl-β-D-xylopyranosyl)oxy]-20, 24-epoxy-16,25-dihydroxy-9,19-cyclolanostan-6-yl | 1324005-51-7 | 2A-2187741 |
| punicalin | 65995-64-4 | 2A-2187747 |
| VINAGINSENOSIDE-R3 | 156012-92-9 | 2A-2187748 |
| vina-ginsenoside R4 | 156009-80-2 | 2A-2187749 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA