
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6953-83-9 |
| Catalog No. | 2A-2187539 |
| Chinese Name | 1-(4-氨基-3-氯苯基)-乙酮 |
| Synonyms | 1-(4-Amino-3-chlorophenyl)ethanone |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.608 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 324.6±27.0 °C at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 95208 |
| SMILES | CC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClNO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,10H2,1H3 |
| InChI Key | VGVXDPRCTIRHOO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| cannabigerol | 25654-31-3 | 2A-2187527 |
| 2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)Methyl)benzonitrile | 1021298-68-9 | 2A-2187529 |
| Siponimod | 1378888-43-7 | 2A-2187530 |
| 1-ethyl-1,2-dihydro-5H-tetrazol-5-one | 69048-98-2 | 2A-2187533 |
| N-Benzyl-2,6-difluoro-3,5-dimethoxyaniline | 651734-53-1 | 2A-2187536 |
| 1-Cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxoq | 94695-52-0 | 2A-2187540 |
| 2-Bromo-4'-chloroacetophenone | 165120-40-1 | 2A-2187541 |
| QUINALDINE SULFATE | 655-76-5 | 2A-2187542 |
| (2-HYDROXYPROPYL)-ALPHA-CYCLODEXTRIN | 99241-24-4 | 2A-2187543 |
| HYDROXYETHYL BETA-CYCLODEXTRIN | 128446-32-2 | 2A-2187544 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA