
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 307297-39-8 |
| Catalog No. | 2A-2187288 |
| Chinese Name | 埃皮塔隆 |
| Synonyms | L-Alanyl-L-α-glutamyl-L-α-aspartylglycine; L-Alanyl-L-α-glutamyl-L-α-asparagylglycin; Epithalon |
| Molecular Formula | C14H22N4O9 |
| Molecular Weight | 2051.17 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 959.8±65.0 °C at 760 mmHg |
| Storage Condition | -20℃, protected from light, stored in inert gas |
| Application | Epitalon is an anti-aging agent and telomerase activator. Epitalon inhibits the development of spontaneous tumors in mice, has geroprotective effects, and increases neuronal activity when administered |
| PubChem ID | 9374247 |
| MDL Number | MFCD01730597 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)NCC(O)=O |
| InChI | InChI=1S/C14H22N4O9/c1-6(15)12(25)17-7(2-3-9(19)20)14(27)18-8(4-10(21)22)13(26)16-5-11(23)24/h6-8H,2-5,15H2,1H3,(H,16,26)(H,17,25)(H,18,27)(H,19,20)(H,21,22)(H,23,24)/t6-,7-,8-/m0/s1 |
| InChI Key | InChIKey=HGHOBRRUMWJWCU-FXQIFTODSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Transport Info | Product name: (S)-4-((S)-2-aminopropionamido)-5-(((S)-3-carboxy-1-((carboxymethyl)amino)-1-oxopropan-2-yl)amino)-5-oxopentanoic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| bisdecanoyl peroxide | 762-12-9 | 2A-2187272 |
| 4-(2-Hydroxyethyl)-alpha,alpha-diMethylphenyl-acetic acid Methyl ester | 1000536-33-3 | 2A-2187274 |
| 2-[1-(4-BROMOPHENYL)-1-METHYLETHYL]-4,4-DIMETHYL-4,5-DIHYDROOXAZOLINE | 192775-97-6 | 2A-2187275 |
| Ethanone, 1-(2,3-dihydro-1H-indol-6-yl)- (9CI) | 147265-76-7 | 2A-2187277 |
| Phosphonic acid, P-[(6-Methyl-2-pyridinyl)(phenylaMino)Methyl]-, diphenyl ester | 614750-85-5 | 2A-2187284 |
| 8-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-one | 132906-53-7 | 2A-2187292 |
| Ethyl 5-fluoro-2-methyl-3-nitrobenzoate | 1342359-36-7 | 2A-2187298 |
| N-(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (Tamibarotene) | 139162-43-9 | 2A-2187299 |
| Bambusa vulgaris, ext. | 91771-33-4 | 2A-2187303 |
| difluoromaleic anhydride | 669-78-3 | 2A-2187306 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA