
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28030-15-1 |
| Catalog No. | 2A-1187119 |
| Chinese Name | 苯丙酸 羟基-4-甲氧基 |
| Synonyms | 4-methoxyphenyllactic acid; latifolicin D |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 647.9 |
| Purity | 98.00 |
| HTC | 2918990090 |
| PubChem ID | 31589262 |
| MDL Number | C39H57N3O5 |
| SMILES | COc1ccc(CC(O)C(=O)O)cc1 |
| InChI | InChI=1S/C10H12O4/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9,11H,6H2,1H3,(H,12,13) |
| InChI Key | GEDLJGYFEOYKEG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenebutanoic acid, 4-hydroxy-, ethyl ester | 62889-58-1 | 2A-2187108 |
| 9-(4-broMobutyl)-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxaMide | 182438-98-8 | 2A-2187112 |
| 2-hydroxy-3-(3-methoxyphenyl)propanoic acid | 1181574-73-1 | 2A-1187046 |
| (+/-)-M-METHOXYMANDELIC ACID | 21150-12-9 | 2A-1187116 |
| (RS)-2-HYDROXY-3-(3-PYRIDYL)-PROPIONIC ACID | 889957-22-6 | 2A-1187118 |
| 2-(3-(But-3-yn-1-yl)-3H-diazirin-3-yl)acetic acid | 2049109-24-0 | 2A-1187120 |
| TP808 | 852821-06-8 | 2A-2187127 |
| 1-benzylazetidin-3-yl methanesulfonate hydrochloride | 292163-60-1 | 2A-2187128 |
| (E)-N-(3-(3-(Dimethylamino)acryloyl)phenyl)-N-methylacetamide | 96605-65-1 | 2A-2187129 |
| Hexahydro-5-Methyl-1-(phenylMethyl)-1H-1,4-diazepine | 150651-61-9 | 2A-2187130 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA