
CAS Number53622-33-6
Synonyms2-Brom-phenanthren-9,10-dion; 2-bromo-phenanthrene-9,10-dione; 2-BroMo-9,10-phenanthrenequinone; QC-1224; 2-Brom-phenanthrenchinon; 2-bromophenanthrenequinone; 2-Bromo-9,10-phenanthrenedione
Molecular FormulaC14H7BrO2
Molecular Weight287.10800
Density1.6±0.1 g/cm3
Boiling Point448.3±24.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53622-33-6 |
| Catalog No. | 2A-3187022 |
| Chinese Name | 2-BroMo-9,10-phenanthrenequinone |
| Synonyms | 2-Brom-phenanthren-9,10-dion; 2-bromo-phenanthrene-9,10-dione; 2-BroMo-9,10-phenanthrenequinone; QC-1224; 2-Brom-phenanthrenchinon; 2-bromophenanthrenequinone; 2-Bromo-9,10-phenanthrenedione |
| Molecular Formula | C14H7BrO2 |
| Molecular Weight | 287.10800 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 448.3±24.0 °C at 760 mmHg |
| HTC | 2914700090 |
| PubChem ID | 36738370 |
| SMILES | O=C1C(=O)c2cc(Br)ccc2-c2ccccc21 |
| InChI | InChI=1S/C14H7BrO2/c15-8-5-6-10-9-3-1-2-4-11(9)13(16)14(17)12(10)7-8/h1-7H |
| InChI Key | DSHTXZUCUCBRAF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2,14,14-Tetramethyl-8-oxopentadecanedioic acid diethyl ester | 738606-43-4 | 2A-3187006 |
| 4-AMino-2-fluorophenolHydrochloride | 1341216-35-0 | 2A-3187010 |
| 3-HEPTEN-2-ONE | 1119-44-4 | 2A-3187011 |
| (1H-imidazol-4-yl)methanone | 91874-85-0 | 2A-3187012 |
| 2-(6-aminopyridin-3-yl)propan-2-ol | 843643-03-8 | 2A-3187013 |
| methyl 4-(methylamino)butanoate hydrochloride | 89584-24-7 | 2A-3187023 |
| diMethyl 2-aMinoisophthalate | 57053-02-8 | 2A-3187025 |
| 4,4-dimethyl-2-pyrrolidinone | 66899-02-3 | 2A-3187026 |
| Benzoic acid, 3-amino-5-ethoxy-, methyl ester (9CI) | 706792-04-3 | 2A-3187027 |
| Carbamic acid, (2-amino-1,1-dimethylethyl)-, 1,1-dimethylethyl ester (9CI) | 320581-09-7 | 2A-3187031 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA