
CAS Number111-79-5
SynonymsMethyl trans-2-nonenoate; 2-Nonenoic acid, methyl ester; Methyl 2-methylnon-2-enoate; MFCD00027316; Methyl 2-nonenoate; Methyl non-2-enoate; EINECS 203-908-7
Molecular FormulaCH3(CH2)5CH=CHCO2CH3
Molecular Weight170.25
Purity≥97%
Density0.9±0.1 g/cm3
Boiling Point115 °C/21 mmHg (lit.)
AppearanceColorless to slightly yellow liquid
EINECS203-908-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 111-79-5 |
| Catalog No. | 2A-9018827 |
| Chinese Name | 2-壬烯酸甲酯 |
| Synonyms | Methyl trans-2-nonenoate; 2-Nonenoic acid, methyl ester; Methyl 2-methylnon-2-enoate; MFCD00027316; Methyl 2-nonenoate; Methyl non-2-enoate; EINECS 203-908-7 |
| Molecular Formula | CH3(CH2)5CH=CHCO2CH3 |
| Molecular Weight | 170.25 |
| Purity | ≥97 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 115 °C/21 mmHg (lit.) |
| Appearance | Colorless to slightly yellow liquid |
| Storage Condition | Store in plastic buckets or aluminum buckets in a |
| EINECS | 203-908-7 |
| PubChem ID | 24901291 |
| MDL Number | MFCD00027316 |
| SMILES | [H]\C(CCCCCC)=C(\[H])C(=O)OC |
| InChI | 1S/C10H18O2/c1-3-4-5-6-7-8-9-10(11)12-2/h8-9H,3-7H2,1-2H3/b9-8+ |
| InChI Key | ZWNPUELCBZVMDA-CMDGGOBGSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| MSDS | msds/18827_1_111_79_5.pdf |
| Transport Info | Product name: trans-2-nonenoic acid methyl ester |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Octane | 111-65-9 | 2A-9018818 |
| Heptylamine | 111-68-2 | 2A-9018819 |
| 1,4-Dicyanobutane | 111-69-3 | 2A-9018820 |
| N,N'-Diethylethylenediamine | 111-74-0 | 2A-9018823 |
| 1,5-Cyclooctadiene | 111-78-4 | 2A-9018826 |
| Methyl 2-nonynoate | 111-80-8 | 2A-9018828 |
| Bis(2-chloroethoxy)methane | 111-91-1 | 2A-9018835 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 | 2A-9018838 |
| Hexadecyl trimethyl ammonium chloride | 112-02-7 | 2A-9018839 |
| Octadecy trimethyl ammonium chloride | 112-03-8 | 2A-9018840 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA