![2,2-Diphenyl-N-[4-(thiazol-2-ylsulfamoyl)-phenyl]-acetamide structure, CAS 313254-51-2](/structures/210000/188143_1_313254_51_2.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 313254-51-2 |
| Catalog No. | 2A-3186813 |
| Chinese Name | ICA-121431 |
| Synonyms | 2,2-Diphenyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide; ICA-121431 |
| Molecular Formula | C23H19N3O3S2 |
| Molecular Weight | 449.55 |
| Density | 1.4±0.1 g/cm3 |
| Storage Condition | 2-8℃ |
| Application | ICA-121431 is a highly effective inhibitor of rat Nav1.7 ion channel with an IC50 value of 19nM, but it has basically no effect on Nav1.7 in humans, dogs and mice. |
| PubChem ID | 3558214 |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O3S2/c27-22(21(17-7-3-1-4-8-17)18-9-5-2-6-10-18)25-19-11-13-20(14-12-19)31(28,29)26-23-24-15-16-30-23/h1-16,21H,(H,24,26)(H,25,27) |
| InChI Key | URSQNPPONHUJDL-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| Transport Info | Product name: ICA 121431 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ZONIPORIDE | 241800-98-6 | 2A-4186803 |
| ACETIC ACID 4-[2-(3,5-DIHYDROXY-PHENYL)-VINYL]-PHENYL ESTER | 411233-11-9 | 2A-3186806 |
| 2-[(1E)-2-(3,5-Dihydroxyphenyl)ethenyl]-1,3-benzenediol | 86361-55-9 | 2A-3186808 |
| Combretastatin A4 disodium phosphate | 168555-66-6 | 2A-3186809 |
| N-VANILLYLDECANAMIDE | 31078-36-1 | 2A-3186810 |
| 4-amino-2-deoxy-2,3-didehydro-N-acetylneuraminic acid | 130525-62-1 | 2A-3186814 |
| 2-(Methylsulfonyl)isonicotinonitrile | 66154-69-6 | 2A-3186816 |
| Swedish Flower Pollen Extract | 2A-4186817 | 2A-4186817 |
| L(+)-IsoValine monohydrate | 1266371-20-3 | 2A-3186818 |
| DL-METHIONINE SULFOXIDE | 62697-73-8 | 2A-3186819 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA