
CAS Number33130-04-0
Synonyms3-(2,3,4-trimethoxy-phenyl)-propionic acid; 2,3,4-trimethoxy-benzenepropanoic acid; 3-(2',3',4'-Trimethoxyphenyl)propanoic acid; QOPNYPCVRBRZOP-UHFFFAOYSA; 3-(2,3,4-Trimethoxy-phenyl)-propionsaeure
Molecular FormulaC12H16O5
Molecular Weight240.26
Density1.169g/cm3
Boiling Point362.3ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33130-04-0 |
| Catalog No. | 2A-1186494 |
| Chinese Name | 3-(2,3,4-三甲氧基苯基)丙酸 |
| Synonyms | 3-(2,3,4-trimethoxy-phenyl)-propionic acid; 2,3,4-trimethoxy-benzenepropanoic acid; 3-(2',3',4'-Trimethoxyphenyl)propanoic acid; QOPNYPCVRBRZOP-UHFFFAOYSA; 3-(2,3,4-Trimethoxy-phenyl)-propionsaeure |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.26 |
| Density | 1.169g/cm3 |
| Boiling Point | 362.3ºC at 760mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 3138066 |
| MDL Number | MFCD00002773 |
| SMILES | COc1ccc(CCC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C12H16O5/c1-15-9-6-4-8(5-7-10(13)14)11(16-2)12(9)17-3/h4,6H,5,7H2,1-3H3,(H,13,14) |
| InChI Key | QOPNYPCVRBRZOP-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-NITROCINNAMIC ACID | 882-06-4 | 2A-1186478 |
| TERT-BUTYL 4-CYANOBENZYLCARBAMATE | 66389-80-8 | 2A-1186480 |
| C-(5-Methyl-[1,2,4]oxadiazol-3-yl)-methylaminehydrochloride | 1184986-84-2 | 2A-1186481 |
| N,N-Diethyl-2,5-difluorobenzaMide | 131401-55-3 | 2A-1186485 |
| METHYL-1 2-CYCLOPENTENE OXIDE 99 | 16240-42-9 | 2A-1186487 |
| 4,5,6-TRIMETHOXY-INDANONE | 16718-42-6 | 2A-1186495 |
| 2-PHENOXYPROPIONYL CHLORIDE | 122-35-0 | 2A-1186498 |
| Benzyl 2-(oxetan-3-ylidene)acetate | 1242160-03-7 | 2A-1186500 |
| 4-(3-Methyl-5-oxo-4,5-dihydro-pyrazol-1-yl)-benzoic acid ethyl ester | 107430-36-4 | 2A-1186502 |
| 3,5-difluoro-4-(5-isopropyl-1,2,4-oxadiazol-3-yl)phenol | 1914136-73-4 | 2A-1186504 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA