
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 156390-35-1 |
| Catalog No. | 2A-1186492 |
| Chinese Name | 4-氧代-1,2,3,4-四氢化萘-1-羧酸甲酯 |
| Synonyms | 4-Oxo-1,2,3,4-tetrahydro-naphthalene-1-carboxylic acid methyl ester; methyl 1,2,3,4-tetrahydro-4-oxonaphthalene carboxylate; Methyl 4-oxo-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2918300090 |
| PubChem ID | 15042761 |
| SMILES | COC(=O)C1CCC(=O)c2ccccc21 |
| InChI | InChI=1S/C12H12O3/c1-15-12(14)10-6-7-11(13)9-5-3-2-4-8(9)10/h2-5,10H,6-7H2,1H3 |
| InChI Key | FJXPXNBKKZUONN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Formaldehyde, reaction products with sulfonated 1,1'-oxybis[methylbenzene], sodium salts | 90387-57-8 | 2A-1186357 |
| 2-[(1,1-diMethylethoxy)carbonyl]hydrazide, 1-oxide | 577778-86-0 | 2A-3186376 |
| (4S-trans)-2,2-Dimethyl-4-phenyl-3,5-oxazolidinedicarboxylic acid 3-(1,1-dimethylethyl) 5-methyl ester | 153652-71-2 | 2A-3186384 |
| 4-CHLORO-2,6-DIMETHOXY PHENYLBORONIC ACID | 1067228-90-3 | 2A-1186476 |
| (S)-(4-(2-((tert-Butoxycarbonyl)aMino)-3-Methoxy-3-oxopropyl)phenyl)boronic acid | 224824-22-0 | 2A-1186477 |
| PIPERONYL FORMALDEHYDE | 6543-34-6 | 2A-1186499 |
| tert-butyl 3-bromo-2-(bromomethyl)propanoate | 75509-27-2 | 2A-1186503 |
| [2-(2,2,2-trifluoroethoxy)phenoxy]acetaldehyde | 1269801-73-1 | 2A-3186516 |
| 4-(2-bromoethoxy)benzaldehyde | 52191-15-8 | 2A-3186525 |
| Cyclic-3-(1,2-ethanediylacetal)-17beta-cyano-17alpha-hydroxy-estra-5(10),9(11)-dien-3-one | 33300-19-5 | 2A-3186621 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA