
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 835616-60-9 |
| Catalog No. | 2A-3186413 |
| Chinese Name | E3连接酶配体4 |
| Molecular Formula | C13H9O4N2F1 |
| Molecular Weight | 276.22 |
| Density | 1.570±0.06 g/cm3(Predicted) |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | 0-10°C; store in inert gas; avoid air, heat |
| Application | E3 ligase Ligand 4 is a ligand for E3 ubiquitin ligase and can be used in PROTAC technology research. |
| PubChem ID | 17171923 |
| MDL Number | MFCD11840666 |
| SMILES | O=C1CCC(N2C(=O)c3cccc(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H9FN2O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5H2,(H,15,17,18) |
| InChI Key | CRAUTELYXAAAPW-UHFFFAOYSA-N |
| Transport Info | Product name: Thalidomide fluoride |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1,3-Dioxane | 505-22-6 | 2A-1186371 |
| 2-[(5-bromo-2-fluorophenyl)Methyl]-Benzo[b]thiophene | 1034305-31-1 | 2A-3186375 |
| Piperazine, 1-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)- (acetate) | 906093-30-9 | 2A-3186378 |
| tert-butyl 4-(4-aMino-5-isopropoxy-2-Methylphenyl)piperidine-1-carboxylate | 1032903-63-1 | 2A-3186381 |
| 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-(((2-methoxyethyl)(methyl)amino)methyl)-5-(4-(3-methoxyureido)phenyl)thiophene-3-carboxylic acid | 737789-93-4 | 2A-1186358 |
| 3-Ethoxycarbonylmethylene-azetidine-1-carboxylic acid tert-butyl ester | 1002355-96-5 | 2A-1186470 |
| 1H-Indazole-4,7-diamine | 918961-26-9 | 2A-1186472 |
| COPPER(I) THIOPHENE-2-CARBOXYLATE | 1292766-17-6 | 2A-1186479 |
| 1-methyl-1H-1,2,4-triazole-3-carbaldehyde | 126748-87-6 | 2A-1186482 |
| 3,4-Pyridinedicarboxylic acid dimethyl ester | 1796-83-4 | 2A-1186483 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA