
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 122661-59-0 |
| Catalog No. | 2A-3186300 |
| Chinese Name | 3-羟基金刚烷羧酸乙酯 |
| Synonyms | Ethyl 3-hydroxyadamantancarboxylate; Tricyclo[3.3.1.13,7]decane-1-carboxylicacid,3-hydroxy-,ethyl ester |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.29600 |
| Density | 1.245g/cm3 |
| Boiling Point | 311.3ºC at 760 mmHg |
| HTC | 2918199090 |
| PubChem ID | 38624062 |
| SMILES | CCOC(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C13H20O3/c1-2-16-11(14)12-4-9-3-10(5-12)7-13(15,6-9)8-12/h9-10,15H,2-8H2,1H3 |
| InChI Key | VVWVYPCOMWTLII-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-ADAMANTANECARBOXZALDEHYDE | 39750-93-1 | 2A-3186276 |
| 4-(1-ADAMANTYL)-3-THIOSEMICARBAZIDE | 52662-65-4 | 2A-3186277 |
| Isopropyl 1-adamantanecarboxylate | 24556-16-9 | 2A-3186283 |
| propyl 1-adaMantanecarboxylate | 24556-15-8 | 2A-3186284 |
| ADAMANTANE-1-CARBOHYDRAZIDE | 17846-15-0 | 2A-3186291 |
| 4,5-Dimethoxybenzocyclobutene-1-carboxylic acid | 41234-23-5 | 2A-1186332 |
| Formaldehyde, polymers with sulfonated 1,1'-oxybis[methylbenzene], sodium salts | 73378-66-2 | 2A-1186356 |
| Formaldehyde, reaction products with sulfonated 1,1'-oxybis[methylbenzene], sodium salts | 90387-57-8 | 2A-1186357 |
| 2-[(1,1-diMethylethoxy)carbonyl]hydrazide, 1-oxide | 577778-86-0 | 2A-3186376 |
| (4S-trans)-2,2-Dimethyl-4-phenyl-3,5-oxazolidinedicarboxylic acid 3-(1,1-dimethylethyl) 5-methyl ester | 153652-71-2 | 2A-3186384 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA