
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1192352-08-1 |
| Catalog No. | 2A-3186091 |
| Chinese Name | 4,7-二溴-5,6-双(辛氧基)-2,1,3-苯并噻二唑 |
| Synonyms | 4,7-Dibromo-5,6-di-n-octyloxy-2,1,3-benzothiadiazole; 4,7-dibromo-5,6-dioctyloxy-2,1,3-benzothiadiazole |
| Molecular Formula | C22H34O2N2Br2S1 |
| Molecular Weight | 550.4 |
| Melting Point | 45 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2934999090 |
| PubChem ID | 226365892 |
| MDL Number | MFCD19440967 |
| SMILES | CCCCCCCCOc1c(OCCCCCCCC)c(Br)c2nsnc2c1Br |
| InChI | InChI=1S/C22H34Br2N2O2S/c1-3-5-7-9-11-13-15-27-21-17(23)19-20(26-29-25-19)18(24)22(21)28-16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| InChI Key | VGCVJZVDAAWTFC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5,6-difluoro-4,7-di(thiophen-2-yl)benzo[c][1,2,5]thiadiazole | 1304773-88-3 | 2A-3186086 |
| 4,7-Bis(5-broMothiophen-2-yl)-5,6-difluorobenzo[c][1,2,5] thiadiazole | 1304773-89-4 | 2A-3186087 |
| 4,4-di(2-ethylhexyl)-4H-cyclopenta[2,1-b:3,4-b]dithiophene | 365547-20-2 | 2A-3186088 |
| 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid | 1024594-86-2 | 2A-3186089 |
| 4,8-Bis[(2-ethylhexyl)oxy]benzo[1,2-b:4,5-b']dithiophene | 1160823-77-7 | 2A-3186090 |
| 2,6-DibroMo-4,8-bis(octyloxy)benzo[1,2-b:4,5-b']dithiophene | 1294515-75-5 | 2A-3186092 |
| 4,8-Bis((2-octyldodecyl)oxy)benzo[1,2-b:4,5-b']dithiophene | 1320201-19-1 | 2A-3186093 |
| 4,8-Bis((2-butyloctyl)oxy)benzo[1,2-b:4,5-b']dithiophene | 1321590-78-6 | 2A-3186095 |
| 1,1'-[4,8-Bis[(2-ethylhexyl)oxy]benzo[1,2-b:4,5-b']dithiophene-2,6-diyl]bis[1,1,1-trimethylstannane] | 1160823-78-8 | 2A-3186096 |
| 7-bromo-benzo[c][1,2,5]thiadiazole-4-carbaldehyde | 1071224-34-4 | 2A-3186097 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA