
CAS Number1078153-58-8
SynonymsTCPB; 4,4',4'',4'''-benzene-1,2,4,5-tetrayltetrabenzoic acid; 1,2,4,5-Tetrakis(4-carboxyphenyl)benzene
Molecular FormulaC34H22O8
Molecular Weight558.53
Density1.393±0.06 g/cm3
Boiling Point792.8±60.0℃(Predicted)
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1078153-58-8 |
| Catalog No. | 2A-3186008 |
| Chinese Name | 1,2,4,5-四(4-羧基苯基)苯 |
| Synonyms | TCPB; 4,4',4'',4'''-benzene-1,2,4,5-tetrayltetrabenzoic acid; 1,2,4,5-Tetrakis(4-carboxyphenyl)benzene |
| Molecular Formula | C34H22O8 |
| Molecular Weight | 558.53 |
| Density | 1.393±0.06 g/cm3 |
| Boiling Point | 792.8±60.0℃(Predicted) |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Insuluble (2.1E-4 g/L) (25 ºC) |
| Storage Condition | 2-8℃ |
| PubChem ID | 93369253 |
| MDL Number | MFCD16621436 |
| SMILES | O=C(O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)c(-c3ccc(C(=O)O)cc3)cc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H22O8/c35-31(36)23-9-1-19(2-10-23)27-17-29(21-5-13-25(14-6-21)33(39)40)30(22-7-15-26(16-8-22)34(41)42)18-28(27)20-3-11-24(12-4-20)32(37)38/h1-18H,(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChI Key | SRTQKANXPMBQCX-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12352103 |
| Transport Info | Product name: 1,2,4,5-tetrakis(4-carboxyphenyl)benzene |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1,2,4,5-Tetraethynylbenzene | 70603-31-5 | 2A-3185756 |
| 1,2,4,5-Tetrakis-(4-formylphenyl)benzene | 883835-33-4 | 2A-3185802 |
| 5,6-DiaMino-3-Methyl-1H-pyriMidin-2,4-dion | 40959-24-8 | 2A-3185879 |
| 4-[2-[2,4,5-Tris[2-(4-aminophenyl)ethynyl]phenyl]ethynyl]aniline | 2375652-88-1 | 2A-3185923 |
| 2,4-Dichlorobenzoyl Cyanide | 35022-43-6 | 2A-3185960 |
| 3-(1-ADAMANTYL)PENTANE-2,4-DIONE | 102402-84-6 | 2A-3186245 |
| (2R)-1-(2,4-difluorophenyl)-2-(tetrahydro-2H-pyran-2-yloxy)propan-1-one | 126918-17-0 | 2A-3186377 |
| 1-(4-(1-(2,6-difluorobenzyl)-5-(((2-methoxyethyl)(methyl)amino)methyl)-3-(6-methoxypyridazin-3-yl)-2,4-dioxo-1,2,3,4-tetrahydrothieno[2,3-d]pyrimidin-6-yl)phenyl)-3-methoxyurea | 737789-61-6 | 2A-1186390 |
| 2,4-DIMETHYLANISOLE | 6738-23-4 | 2A-3186607 |
| (3aS,6aR)-1,3-dibenzyltetrahydro-1H-furo[3,4-d]imidazole-2,4-dione | 28092-62-8 | 2A-3186611 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA