![4',4''',4'''''-nitrilotris(([1,1'-biphenyl]-4-carboxylic acid)) structure, CAS 1239602-35-7](/structures/210000/187238_1_1239602_35_7.png)
CAS Number1239602-35-7
SynonymsTCPA; H3TCBPA; tris(4-carboxylphenylduryl)amine; tris(4'-carboxybiphenyl)amine; 4',4''',4'''''-nitrilotris(([1,1'-biphenyl]-4-carboxylic acid))
Molecular FormulaC39H27O6N1
Molecular Weight605.65
Density1.333±0.06 g/ml(Predicted)
Boiling Point874.1±65.0℃(Predicted)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1239602-35-7 |
| Catalog No. | 2A-3185933 |
| Chinese Name | Antibacterial agent 18 |
| Synonyms | TCPA; H3TCBPA; tris(4-carboxylphenylduryl)amine; tris(4'-carboxybiphenyl)amine; 4',4''',4'''''-nitrilotris(([1,1'-biphenyl]-4-carboxylic acid)) |
| Molecular Formula | C39H27O6N1 |
| Molecular Weight | 605.65 |
| Density | 1.333±0.06 g/ml(Predicted) |
| Boiling Point | 874.1±65.0℃(Predicted) |
| Storage Condition | 2-8℃ |
| Application | Antibacterial agent 18 is a multi-arm AIE molecule. For detailed information, please refer to compound 23 in the patent document CN110123801A. Antibacterial agent 18 can be used to inhibit the growth |
| PubChem ID | 252088696 |
| MDL Number | MFCD31700772 |
| SMILES | O=C(O)c1ccc(-c2ccc(N(c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3ccc(-c4ccc(C(=O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H27NO6/c41-37(42)31-7-1-25(2-8-31)28-13-19-34(20-14-28)40(35-21-15-29(16-22-35)26-3-9-32(10-4-26)38(43)44)36-23-17-30(18-24-36)27-5-11-33(12-6-27)39(45)46/h1-24H,(H,41,42)(H,43,44)(H,45,46) |
| InChI Key | NWYGETXZXGDGKD-UHFFFAOYSA-N |
| Transport Info | Product name: 4',4''',4'''''-nitrilotris([1,1'-biphenyl]-4-carboxylic acid) |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,5-Diethoxy-benzene-1,4-dicarbaldehyde | 56766-03-1 | 2A-3185915 |
| 2,5-Dibutoxy-benzene-1,4-dicarbaldehyde | 564456-59-3 | 2A-3185916 |
| 2,5-Bis(octyloxy)terephthalaldehyde | 123440-34-6 | 2A-3185917 |
| 2',5'-Dibutoxy-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde | 1501954-20-6 | 2A-3185918 |
| 2,5-Diethoxyterephthalohydrazide | 1136292-71-1 | 2A-3185924 |
| 5''-(3',5'-Dicarboxy[1,1'-biphenyl]-4-yl)[1,1':4',1'':3'',1''':4''',1''''-quinquephenyl]-3,3'''',5,5''''-tetracarboxylic acid | 1126896-14-7 | 2A-3185935 |
| α,α,α’,α’-Tetramethyl-5-(dibromomethyl)-1,3-benzenediacetonitrile | 1027160-12-8 | 2A-3185962 |
| 5-[4-(3,5-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid | 921619-89-8 | 2A-3185991 |
| [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid | 1542274-12-3 | 2A-3185992 |
| 5',5''''-(anthracene-9,10-diyl)bis(([1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid)) | 913343-74-5 | 2A-3186001 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA