
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 113682-56-7 |
| Catalog No. | 2A-3185868 |
| Chinese Name | 1,4-二(对吡啶基)苯 |
| Synonyms | MFCD00445845 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28 |
| Melting Point | 193 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2933399090 |
| PubChem ID | 7812919 |
| MDL Number | MFCD00445845 |
| SMILES | c1cc(-c2ccc(-c3ccncc3)cc2)ccn1 |
| InChI | InChI=1S/C16H12N2/c1-2-14(16-7-11-18-12-8-16)4-3-13(1)15-5-9-17-10-6-15/h1-12H |
| InChI Key | MAWKLXRVKVOYLR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| [1,4,:4,1,,-Terphenyl]-4,4,,-diacetonitrile | 1000559-50-1 | 2A-3185856 |
| 4',4''',4''''',4'''''''-(Ethene-1,1,2,2-tetrayl)tetrakis(([1,1'-biphenyl]-4-amine)) | 2252187-21-4 | 2A-3185863 |
| 4,4',4'',4'''-silanetetrayltetrabenzoic acid | 10256-84-5 | 2A-3185865 |
| 4,4'-Dibromo-2,2'-diiodo-1,1'-biphenyl | 852138-89-7 | 2A-3185866 |
| Tetrakis(4-pyridylphenyl)ethylene | 1227195-24-5 | 2A-3185867 |
| 4,4'-di(1H-iMidazol-1-yl)-1,1'-biphenyl | 855766-92-6 | 2A-3185869 |
| 1,3,5-tris(4-pyridyl)benzene | 170165-84-1 | 2A-3185871 |
| Diphenylethyne-3,3',5,5'-tetracarboxylicacid | 957014-38-9 | 2A-3185872 |
| Benzoic acid, 4,4',4'',4''',4'''',4'''''-(1,2,3,4,5,6-benzenehexaylhexa-2,1-ethynediyl)hexakis- | 684216-81-7 | 2A-3185877 |
| 2-acetylamino-6-chloro-4-[(4-diethylamino)2-methylphenyl-imino]-5-methyl-1-oxo-2,5-cyclohexadiene | 102387-48-4 | 2A-3185880 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA