
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 205687-01-0 |
| Catalog No. | 2A-3185447 |
| Chinese Name | 辣椒素酯 |
| Synonyms | Capsiate Natura; UNII-PX8I7HG5I3; capsiate |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 |
| Boiling Point | 421.3±40.0 °C(Predicted) |
| Appearance | oily liquid |
| Storage Condition | 2-8°C, sealed, dry |
| Application | Capsaicin, as a capsaicin analogue, is extracted from the non-spicy variety CH-19 bell pepper and is an orally active agonist of TRPV1 [1]. |
| PubChem ID | 14800733 |
| MDL Number | MFCD28401009 |
| SMILES | COc1cc(COC(=O)CCCCC=CC(C)C)ccc1O |
| InChI | InChI=1S/C18H26O4/c1-14(2)8-6-4-5-7-9-18(20)22-13-15-10-11-16(19)17(12-15)21-3/h6,8,10-12,14,19H,4-5,7,9,13H2,1-3H3/b8-6+ |
| InChI Key | ZICNYIDDNJYKCP-SOFGYWHQSA-N |
| Beilstein/REAXYS | 7933697 |
| NACRES Code | NA.24 |
| UNSPSC | 85151701 |
| Transport Info | Product name: Leader |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Mercaptopropylmethyldiethoxysilane | 2A-3185442 | 2A-3185442 |
| ALLYLTRIMETHOXYSILANE | 2551-83-9 | 2A-3185443 |
| Silane, triethoxy(isocyanatomethyl)- | 132112-76-6 | 2A-3185444 |
| (Isocyanatomethyl)trimethoxysilane | 78450-75-6 | 2A-3185445 |
| Ostrea edulis, ext. | 94465-79-9 | 2A-3185446 |
| PROPOLIS | 9009-62-5 | 2A-3185448 |
| Apple, Malus sylvestris, ext. | 85251-63-4 | 2A-3185449 |
| Purple Sweet Potato Extract | 2A-3185451 | 2A-3185451 |
| Marshmallow Extract | 2A-3185452 | 2A-3185452 |
| Taro powder | 2A-3185453 | 2A-3185453 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA