
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15308-01-7 |
| Catalog No. | 2A-3185172 |
| Chinese Name | 2,2',6'-三氯-N-苯基乙酰苯胺 |
| Synonyms | 2-chloro-N-(2,6-dichlorophenyl)-N-phenylacetamide |
| Molecular Formula | C14H10Cl3NO |
| Molecular Weight | 314.6 |
| Density | 1.411 g/cm3 |
| Boiling Point | 487.5ºC at 760 mmHg |
| Melting Point | 143 - 145ºC |
| Appearance | White to off-white crystalline powder |
| Storage Condition | 2-8°C |
| HTC | 2924299090 |
| PubChem ID | 6431554 |
| SMILES | O=C(CCl)N(c1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H10Cl3NO/c15-9-13(19)18(10-5-2-1-3-6-10)14-11(16)7-4-8-12(14)17/h1-8H,9H2 |
| InChI Key | BPEUHDIEZQWRGC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| SURFACTIN | 24730-31-2 | 2A-3185166 |
| 4-METHYLIMIDAZOLIDINE-2-THIONE | 2122-19-2 | 2A-3185167 |
| BenzenaMine, 2-[(1-Methylethyl)thio]-, hydrochloride | 861343-73-9 | 2A-3185168 |
| 4-AMINO-6-CHLORO-BENZENE-1,3-DISULFONYL DICHLORIDE | 671-89-6 | 2A-3185170 |
| 2,6-DICHLORODIPHENYLAMINE | 15307-93-4 | 2A-3185171 |
| TOFOGLIFLOZIN | 1201913-82-7 | 2A-3185173 |
| Methyl 1-C-[3-(benzo[b]thien-2-ylMethyl)-4-fluorophenyl]- | 1034305-23-1 | 2A-3185174 |
| 4-Bromonaphthalene-1-carbonitrile | 92616-49-4 | 2A-3185176 |
| bromine water | 2A-3185177 | 2A-3185177 |
| 4-(2,2-Dichlorocyclopropyl)phenol 1-acetate | 144900-34-5 | 2A-3185179 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA