
CAS Number2396-80-7
Synonymshex-5-enoic acid methyl ester; MFCD00671538; 5-Hexenoic Acid Methyl Ester; Hex-5-ensaeure-methylester; methyl-5-hexenoate
Molecular FormulaCH3OCOCH2CH2CH(NH2)COOH
Molecular Weight161.16
Density0.91 g/cm3
Boiling Point157ºC
AppearanceColorless - almost colorless transparent liquid
EINECS216-110-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2396-80-7 |
| Catalog No. | 2A-1185074 |
| Chinese Name | 5-己烯酸甲酯 |
| Synonyms | hex-5-enoic acid methyl ester; MFCD00671538; 5-Hexenoic Acid Methyl Ester; Hex-5-ensaeure-methylester; methyl-5-hexenoate |
| Molecular Formula | CH3OCOCH2CH2CH(NH2)COOH |
| Molecular Weight | 161.16 |
| Density | 0.91 g/cm3 |
| Boiling Point | 157ºC |
| Appearance | Colorless - almost colorless transparent liquid |
| Storage Condition | room temperature, dry |
| Packaging | III |
| EINECS | 216-110-9 |
| HTC | 2916190090 |
| PubChem ID | 24888459 |
| MDL Number | MFCD00002632 |
| SMILES | C=CCCCC(=O)OC |
| InChI | InChI=1S/C7H12O2/c1-3-4-5-6-7(8)9-2/h3H,1,4-6H2,2H3 |
| InChI Key | ASKDFGVMJZMYEM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1725252 |
| NACRES Code | NA.22 |
| UNSPSC | 12352209 |
| Hazard Symbols | Category 3 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 3272 Formal shipping name: Ester, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| NISTC51770980 | 51770-98-0 | 2A-1185064 |
| ethoxyacetyl chloride | 14077-58-8 | 2A-1185065 |
| tert-Butyl 2-(2-Chloroethoxy)acetate | 73834-55-6 | 2A-1185069 |
| 3,3-DIETHOXY-PROPIONIC ACID | 6191-97-5 | 2A-1185072 |
| Ethyl-5-hexenoate | 54653-25-7 | 2A-1185073 |
| 5-IODO-2-FUROIC ACID,97% | 18614-11-4 | 2A-1185075 |
| Ethyl-2-benzylsulfonyl acetate | 29771-81-1 | 2A-1185079 |
| METHYL 2-BENZYLSULFONYLACETATE | 29771-82-2 | 2A-1185080 |
| 5-bromo-2-furamide | 6134-61-8 | 2A-1185082 |
| Oxetan-3-yl Methanesulfonate | 148430-81-3 | 2A-1185084 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA