
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 131275-93-9 |
| Catalog No. | 2A-3184998 |
| Chinese Name | (3R,5S)-阿托伐他汀钠盐 |
| Synonyms | (3R,5S)-Atorvastatin Sodium Salt |
| Molecular Formula | C33H34FN2NaO5 |
| Molecular Weight | 580.622 |
| Storage Condition | -20°C, dry, sealed |
| Application | (3R,5S)-Atorvastatin sodium is an impurity of Atorvastatin. Atorvastatin is an orally active HMG-CoA reductase inhibitor with the ability to effectively lower blood lipids. Atorvastatin inhibits human |
| PubChem ID | 99004605 |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C33H35FN2O5.Na/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);/q;+1/p-1/t26-,27+;/m0./s1 |
| InChI Key | VVRPOCPLIUDBSA-MFHXMFJOSA-M |
| Transport Info | Product name: (3R, 5S)-Atorvastatin sodium salt |
| Related Products in Analytical Standards | ||
|---|---|---|
| Valdecoxib IMpurity B | 1373038-60-8 | 2A-3184877 |
| Prasugrel Impurity III | 1391194-50-5 | 2A-3184881 |
| Palbociclib Impurity N-Oxide | 2174002-29-8 | 2A-3184883 |
| Palbociclib impurity 4 | 2A-3184885 | 2A-3184885 |
| Eletriptan Impurity 14 | 6163-63-9 | 2A-3184886 |
| Palbociclib impurity 33 | 1974279-40-7 | 2A-3185009 |
| Palbociclib Impurity 87 | 571189-51-0 | 2A-3185010 |
| Palbociclib Impurity I | 2172256-78-7 | 2A-3185013 |
| Tedizolid Impurity 3 | 1835340-19-6 | 2A-3185018 |
| Tedizolid Impurity 34 | 2095200-69-2 | 2A-0202146 |
| Browse all Analytical Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA