
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51333-75-6 |
| Catalog No. | 2A-1184929 |
| Chinese Name | 4-己基苯甲酸-4-氰基苯酯 |
| Synonyms | 2-(Methylthio)phenyl isothiocyanate; 1-isothiocyanato-2-methylsulfanylbenzene; MFCD00041061 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 182.24 |
| Density | 1.227 |
| Boiling Point | 149ºC (10 torr) |
| Appearance | light yellow liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 2930909090 |
| PubChem ID | 329819680 |
| MDL Number | MFCD11898922 |
| SMILES | CSc1ccccc1N=C=S |
| InChI | InChI=1S/C8H7NS2/c1-11-8-5-3-2-4-7(8)9-6-10/h2-5H,1H3 |
| InChI Key | SIODOISHDGRELW-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| Hazard Symbols | 6.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-2-Methyl Glycidol | 86884-90-4 | 2A-1184904 |
| Carbamic acid,N-[5-[(4-methylphenyl)sulfonyl]-5H-pyrrolo[2,3-b]pyrazin-2-yl]-, ethyl este | 1869118-24-0 | 2A-1184916 |
| 8-((3R,4S)-4-ethylpyrrolidin-3-yl)-3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazine | 1708997-43-6 | 2A-1184919 |
| (3R,4S)-1-[(benzyloxy)carbonyl]-4-ethylpyrrolidine-3-carboxylic acid | 1428243-25-7 | 2A-1184920 |
| 4-(METHYLTHIO)PHENYL ISOTHIOCYANATE | 15863-41-9 | 2A-1184928 |
| 1,4-PHENYLENE DIISOTHIOCYANATE | 4044-65-9 | 2A-1184930 |
| (R)-(-)-2-HEXYL ISOTHIOCYANATE | 737000-95-2 | 2A-1184937 |
| ACETYL ISOTHIOCYANATE | 13250-46-9 | 2A-1184947 |
| (1R,2R)-2-CYCLOPROPYLAMINO CYCLOHEXANOL | 189362-43-4 | 2A-1185000 |
| (2R,4S)-4-nitrobenzyl 4-Mercapto-2-((sulfaMoylaMino)Methyl)pyrrolidine-1-carboxylate | 148017-03-2 | 2A-3185003 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA