
CAS Number6026-86-4
Synonymsmethyl 4-formylbutyrate; Methyl 4-formylbutanoate; [(2,4,4-Trimethyl-2-pentanyl)sulfanyl]acetic acid; methyl 5-oxopenanoate; methyl 5-oxo-pentanoate; 5-oxopentanoic acid methyl ester; [(2,4,4-Trimethylpentan-2-yl)sulfanyl]acetic acid; 4-methoxycarbonyl-butanal; Pentanoic acid,5-oxo-,methyl ester; 5-Oxo-pentanoic acid methyl ester
Molecular FormulaC10H20O2S
Molecular Weight130.14
Density1.0±0.1 g/cm3
Boiling Point289.1±23.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6026-86-4 |
| Catalog No. | 2A-3184890 |
| Chinese Name | 5-氧代戊酸甲酯 |
| Synonyms | methyl 4-formylbutyrate; Methyl 4-formylbutanoate; [(2,4,4-Trimethyl-2-pentanyl)sulfanyl]acetic acid; methyl 5-oxopenanoate; methyl 5-oxo-pentanoate; 5-oxopentanoic acid methyl ester; [(2,4,4-Trimethylpentan-2-yl)sulfanyl]acetic acid; 4-methoxycarbonyl-butanal; Pentanoic acid,5-oxo-,methyl ester; 5-Oxo-pentanoic acid methyl ester |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 130.14 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 289.1±23.0 °C at 760 mmHg |
| Storage Condition | -20°C, sealed, dry |
| HTC | 2918300090 |
| PubChem ID | 8678981 |
| SMILES | COC(=O)CCCC=O |
| InChI | InChI=1S/C6H10O3/c1-9-6(8)4-2-3-5-7/h5H,2-4H2,1H3 |
| InChI Key | YBTZROCKNUIONO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-(2-cyclopropyl-2-oxo-1-phenylethyl)-4,5,6,7-tetrahydrothieno [3,2-c]pyridin-2-yl acetate | 1391194-45-8 | 2A-3184882 |
| Methyl 4-broMo-2,5-difluorobenzoate | 1193162-21-8 | 2A-3184883 |
| 5-(piperazin-1-yl)pyridin-2-aMine | 1082876-26-3 | 2A-3184887 |
| methyl 4-bromo-3,5-difluorobenzoate | 1803565-64-1 | 2A-3184884 |
| 4-BROMO-[1,1-BIPHENYL]-3-OL | 149950-41-4 | 2A-3184889 |
| 2-bromo-N-isopropyl-5-nitropyridin-4-amine | 1612171-82-0 | 2A-3184896 |
| Hydroxy-PEG1-CH2CO2tBu | 287174-32-7 | 2A-3184898 |
| 4-FLUORO-7-HYDROXY-1-INDANONE | 136191-16-7 | 2A-3184899 |
| 3-AMINO-5-CHLOROPYRIDAZIN-4-YLAMINE | 89123-72-8 | 2A-3184900 |
| Ethane,1,1'-Oxybis〔2-(2-bromoethoxy)- | 31255-26-2 | 2A-3184901 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA