
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31600-43-8 |
| Catalog No. | 2A-1184815 |
| Chinese Name | 苄氧乙酸甲酯 |
| Synonyms | benzyloxyacetic acid methyl ester; Acetic acid, 2-(phenylmethoxy)-, methyl ester; Methyl (benzyloxy)acetate |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 267.9±15.0 °C at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918990090 |
| PubChem ID | 16852156 |
| SMILES | COC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C10H12O3/c1-12-10(11)8-13-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChI Key | QNEIZSSWCVSZOS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| cataCXium A-Pd-G2 | 1375477-29-4 | 2A-1184804 |
| ethyl 2-(ethoxycarbonylmethoxy)acetate | 6634-17-9 | 2A-1184806 |
| 4-CHLORO-3-FLUOROBENZOIC ACID ETHYL ESTER | 203573-08-4 | 2A-1184807 |
| meso-Tetra (p-bromophenyl) porphine | 29162-73-0 | 2A-1184813 |
| METHYL (2-CYANOPHENYL)ACETATE | 20921-96-4 | 2A-1184814 |
| 3-amino-4-(4-methyl-1-piperidyl)benzoic acid methyl ester | 883291-30-3 | 2A-1184816 |
| METHYL 3-AMINO-5-METHOXYBENZOATE | 217314-47-1 | 2A-1184817 |
| methyl 3-formyl-2-methoxybenzoate | 186312-96-9 | 2A-1184818 |
| 4-BroMo-2-chloro-5-nitro-benzoic acid Methyl ester | 1157672-86-0 | 2A-1184819 |
| Methyl 4-fluoro-2-methyl-5-nitrobenzoate 98% | 1163287-01-1 | 2A-1184820 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA