CAS Number610-17-3
SynonymsN,N-Dimethyl-2-nitroaniline; 2-Nitro-NN-dimethylaniline; N,N-dimethylaminonitrobenzene; NN-Dimethyl-2-nitroaniline
Molecular FormulaC8H10N2O2
Molecular Weight166.181
Density1.2±0.1 g/cm3
Boiling Point257.7±23.0 °C at 760 mmHg
Melting Point57-58ºC
Appearancebrown liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-17-3 |
| Catalog No. | 2A-3184787 |
| Chinese Name | N,N-二甲基-3-硝基苯胺 |
| Synonyms | N,N-Dimethyl-2-nitroaniline; 2-Nitro-NN-dimethylaniline; N,N-dimethylaminonitrobenzene; NN-Dimethyl-2-nitroaniline |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.181 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 257.7±23.0 °C at 760 mmHg |
| Melting Point | 57-58ºC |
| Appearance | brown liquid |
| Storage Condition | The warehouse is ventilated and dried at low tempe |
| HTC | 2921430090 |
| PubChem ID | 3216554 |
| MDL Number | MFCD00059083 |
| SMILES | CN(C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O2/c1-9(2)7-5-3-4-6-8(7)10(11)12/h3-6H,1-2H3 |
| InChI Key | NPZDNLCYFLDJFA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-(HYDROXYMETHYL)NICOTINONITRILE | 31795-61-6 | 2A-1184757 |
| 4-Amino-2-hydroxybenzyl alcohol | 40463-78-3 | 2A-1184760 |
| (2S)-Isopropyl 2-(((perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate | 1256490-52-4 | 2A-3184765 |
| 3,4-Dihydroxybenzoic acid monopotassium salt | 91753-30-9 | 2A-3184773 |
| Cyclopropyl 2-Fluorophenyl Diketone | 1391054-37-7 | 2A-3184784 |
| 1,2-Cyclopentanediamine | 41330-23-8 | 2A-3184792 |
| 4-Carboxy-Pennsylvania Green | 879288-14-9 | 2A-1184793 |
| 4-Iodo-3-methoxyaniline | 1112840-98-8 | 2A-1184794 |
| 1-Hydroxy-4-iodonaphthalene | 113855-57-5 | 2A-1184795 |
| 5,10,15,20-TETRAKIS(4-AMINOPHENYL)-21H,23H-PORPHINE | 22112-84-1 | 2A-1184798 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS