
CAS Number108-16-7
Synonyms(±)-1-(Dimethylamino)-2-propanol; 1-(Dimethylamino)-2-propanol; 1-(dimethylamino)propan-2-ol; (±)-1-(N,N-Dimethylamino)-2-propanol; DL-1-(Dimethylamino)-2-propanol; N,N-Dimethylisopropanolamine; EINECS 203-556-4; N,N-dimethylaminoisopropanol; 1-Dimethylamino-2-propanol; Bisomer Amine D 700; 1,1-(Dimethylamino)-2-propanol; Dimepranol; UNII:OX17195H4T; MFCD00004532
Molecular FormulaCH3CH(OH)CH2N(CH3)2
Molecular Weight103.16
Purity≥99%
Density0.9±0.1 g/cm3
Boiling Point121-127 °C (lit.)
Melting Point-40ºC
AppearanceTransparent to light yellow liquid
EINECS203-556-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108-16-7 |
| Catalog No. | 2A-9018595 |
| Chinese Name | N,N-二甲基异丙醇胺 |
| Synonyms | (±)-1-(Dimethylamino)-2-propanol; 1-(Dimethylamino)-2-propanol; 1-(dimethylamino)propan-2-ol; (±)-1-(N,N-Dimethylamino)-2-propanol; DL-1-(Dimethylamino)-2-propanol; N,N-Dimethylisopropanolamine; EINECS 203-556-4; N,N-dimethylaminoisopropanol; 1-Dimethylamino-2-propanol; Bisomer Amine D 700; 1,1-(Dimethylamino)-2-propanol; Dimepranol; UNII:OX17195H4T; MFCD00004532 |
| Molecular Formula | CH3CH(OH)CH2N(CH3)2 |
| Molecular Weight | 103.16 |
| Purity | ≥99 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 121-127 °C (lit.) |
| Melting Point | -40ºC |
| Appearance | Transparent to light yellow liquid |
| Water Solubility | miscible |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | II |
| EINECS | 203-556-4 |
| HTC | 29221980 |
| PubChem ID | 24870740 |
| MDL Number | MFCD00004532 |
| SMILES | CC(O)CN(C)C |
| InChI | 1S/C5H13NO/c1-5(7)4-6(2)3/h5,7H,4H2,1-3H3 |
| InChI Key | NCXUNZWLEYGQAH-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1209244 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/18595_1_108_16_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Nitropropane | 108-03-2 | 2A-9018587 |
| 1,3-Dimethylbutylamine | 108-09-8 | 2A-9018589 |
| Isovaleryl chloride | 108-12-3 | 2A-9018592 |
| Malonamide | 108-13-4 | 2A-9018593 |
| 1-(Dimethylamino)-2-propylamine | 108-15-6 | 2A-9018594 |
| Isopropyl chloroformate | 108-23-6 | 2A-9018601 |
| 3-Methyl-2-pyrazolin-5-one | 108-26-9 | 2A-9018603 |
| 3-Bromochlorobenzene | 108-37-2 | 2A-9018610 |
| 3-Methylbenzenethiol | 108-40-7 | 2A-9018613 |
| 2,4-Lutidine | 108-47-4 | 2A-9018620 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA