
CAS Number40292-15-7
Synonyms4-Brom-4'-nitro-benzophenon; 4-bromophenyl 4-nitrophenyl ketone; (4-Brom-phenyl)-(4-nitro-phenyl)-keton; 4-bromophenyl(4-nitrophenyl)methanone; HMS557K14; 4-Bromo-4'-nitrobenzophenone
Molecular FormulaO2NC6H4COC6H5
Molecular Weight227.22
Density1.565g/cm3
Boiling Point438.4ºC at 760 mmHg
EINECS214-542-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40292-15-7 |
| Catalog No. | 2A-1184493 |
| Chinese Name | 4-溴-4'-硝基二苯甲酮 |
| Synonyms | 4-Brom-4'-nitro-benzophenon; 4-bromophenyl 4-nitrophenyl ketone; (4-Brom-phenyl)-(4-nitro-phenyl)-keton; 4-bromophenyl(4-nitrophenyl)methanone; HMS557K14; 4-Bromo-4'-nitrobenzophenone |
| Molecular Formula | O2NC6H4COC6H5 |
| Molecular Weight | 227.22 |
| Density | 1.565g/cm3 |
| Boiling Point | 438.4ºC at 760 mmHg |
| Storage Condition | room temperature |
| EINECS | 214-542-2 |
| HTC | 2914700090 |
| PubChem ID | 24897469 |
| MDL Number | MFCD00007354 |
| SMILES | O=C(c1ccc(Br)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H8BrNO3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(8-4-10)15(17)18/h1-8H |
| InChI Key | SXYMUGJXZKDIRK-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1912753 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2,4,6-TETRA-O-ACETYL-3-O-BENZYL-BETA-D-GLUCOPYRANOSE | 39686-94-7 | 2A-1184487 |
| -D-Galactopyranosylamine | 6318-23-6 | 2A-1184489 |
| 1-Galloyl-glucose | 13405-60-2 | 2A-1184490 |
| p-chloro-alpha,alpha-dimethylbenzyl alcohol | 1989-25-9 | 2A-1184491 |
| p-chloro-alpha,alpha-dimethylbenzyl alcohol | 52009-53-7 | 2A-1184492 |
| 5-BroMo-3-fluoro-2-Methylaniline | 886761-86-0 | 2A-1184494 |
| ethyl 4-(4-formyl-3-hydroxyphenoxy)butanoate | 152942-06-8 | 2A-1184495 |
| (4-Aminophenoxy)acetic acid methyl ester | 59954-04-0 | 2A-1184496 |
| N-(4-Nitrophenyl)benzenesulfonaMide, 97% | 1829-81-8 | 2A-1184498 |
| 2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol | 1174225-19-4 | 2A-1184499 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA