
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41248-23-1 |
| Catalog No. | 2A-3184117 |
| Chinese Name | 1-乙氧羰基-1-环戊醇 |
| Synonyms | ethyl 1-hydroxycyclopentane-1-carboxylate; ETHYL 1-HYDROXYCYCLOPENTANE-CARBOXYLATE |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.19500 |
| Density | 1.144 |
| Boiling Point | 206ºC |
| Storage Condition | 2-8°C |
| HTC | 2918199090 |
| PubChem ID | 85246116 |
| InChI | InChI=1S/C8H14O3/c1-2-11-7(9)8(10)5-3-4-6-8/h10H,2-6H2,1H3 |
| InChI Key | GINOXNRTFZITQJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| TRIS[3,5-BIS(TRIFLUOROMETHYL)PHENYL]PHOSPHINE | 175136-62-6 | 2A-3184040 |
| 4-phenylnaphthalen-1-ylboronic acid | 16241-07-5 | 2A-1184068 |
| Fluoranthene-3-boronic acid | 359012-63-8 | 2A-1184072 |
| (4-Fluorothiophen-2-yl)boronic acid | 1360465-66-2 | 2A-1184079 |
| [(2-{Bis[3,5-bis(trifluoromethyl)phenyl]phosphine}-3,6-dimethoxy- 2′,4′,6′- triisopropyl-1,1′-biphenyl )-2-(2′-amino-1,1′-biphenyl)]palladium(II) methanesulfonate | 2102544-35-2 | 2A-3184084 |
| Cyclopentanecarboxylic acid, 1-acetyl-, methyl ester (9CI) | 171924-94-0 | 2A-3184118 |
| Di[4-(trifluoromethyl)phenyl]-phenylphosphine | 39134-71-9 | 2A-3184144 |
| 3-(Phenylhexyl)phenylboronic acid | 1795440-43-5 | 2A-3184272 |
| 2-Trifluoromethyl-5-Nitrobenzonitrile | 887350-95-0 | 2A-3184315 |
| [2-(2,2,2-trifluoroacetyl)pyridin-4-yl]boronic acid | 1310404-58-0 | 2A-3184331 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA