
CAS Number106-29-6
SynonymsMFCD00036538; EINECS 203-381-3; Butanoic acid, 3,7-dimethyl-2,6-octadien-1-yl ester; GERANYL BUTYRATE; 3,7-Dimethylocta-2,6-dien-1-yl butyrate; 3,7-Dimethyl-2,6-octadien-1-yl butyrate
Molecular FormulaCH3CH2CH2CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2
Molecular Weight224.34
Purity≥95%
Density0.9±0.1 g/cm3
Boiling Point151-153 °C/18 mmHg (lit.)
AppearanceColorless to light yellow liquid
EINECS203-381-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 106-29-6 |
| Catalog No. | 2A-9018483 |
| Chinese Name | 丁酸叶醇酯 |
| Synonyms | MFCD00036538; EINECS 203-381-3; Butanoic acid, 3,7-dimethyl-2,6-octadien-1-yl ester; GERANYL BUTYRATE; 3,7-Dimethylocta-2,6-dien-1-yl butyrate; 3,7-Dimethyl-2,6-octadien-1-yl butyrate |
| Molecular Formula | CH3CH2CH2CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2 |
| Molecular Weight | 224.34 |
| Purity | ≥95 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 151-153 °C/18 mmHg (lit.) |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Glass bottle packaging. Store in a cool and ventil |
| EINECS | 203-381-3 |
| HTC | 2930200015 |
| PubChem ID | 24900980 |
| MDL Number | MFCD00036538 |
| SMILES | [H]\C(CC\C(C)=C(/[H])COC(=O)CCC)=C(/C)C |
| InChI | 1S/C14H24O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h8,10H,5-7,9,11H2,1-4H3/b13-10+ |
| InChI Key | ZSBOMYJPSRFZAL-JLHYYAGUSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| MSDS | msds/18483_2_106_29_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | S (Import and export pesticide registration certificate) |
| Transport Info | Product name: Geranyl butyrate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethylene brassylate | 105-95-3 | 2A-9018472 |
| Dibutyl adipate | 105-99-7 | 2A-9018473 |
| Cyclopentadecanolide | 106-02-5 | 2A-9018474 |
| Dipropyl adipate | 106-19-4 | 2A-9018475 |
| Bis(2-ethylhexyl)amine | 106-20-7 | 2A-9018476 |
| Ethyl heptanoate | 106-30-9 | 2A-9018484 |
| Ethyl caprylate | 106-32-1 | 2A-9018486 |
| Quinhydrone | 106-34-3 | 2A-9018488 |
| 3-Heptanone | 106-35-4 | 2A-9018489 |
| Propyl propionate | 106-36-5 | 2A-9018490 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA