
CAS Number20585-39-1
Synonymsα-Cyclohexylmandelic acid; (2R)-Cyclohexyl(hydroxy)phenylacetic acid; |A-cyclohexylmandelic acid; 2-Cyclohexyl-2-phenylglycolic acid; Cyclohexylphenylglycolic acid; 2-cyclohexylmandelic acid; Hexahydrobenzilic acid; UNII:QH762W903U; Lespedamine; Cyclohexylmandelic acid; Cyclohexyl(hydroxy)phenylacetic acid; (2S)-Cyclohexyl(Hydroxy)Phenylacetic Acid; (R)-Cyclohexylhydroxyphenylacetic Acid
Molecular FormulaC14H18O3
Molecular Weight234.291
Density1.206g/cm3
Boiling Point408.579°C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20585-39-1 |
| Catalog No. | 2A-3183636 |
| Chinese Name | (2S)-环己基(羟基)苯基乙酸 |
| Synonyms | α-Cyclohexylmandelic acid; (2R)-Cyclohexyl(hydroxy)phenylacetic acid; |A-cyclohexylmandelic acid; 2-Cyclohexyl-2-phenylglycolic acid; Cyclohexylphenylglycolic acid; 2-cyclohexylmandelic acid; Hexahydrobenzilic acid; UNII:QH762W903U; Lespedamine; Cyclohexylmandelic acid; Cyclohexyl(hydroxy)phenylacetic acid; (2S)-Cyclohexyl(Hydroxy)Phenylacetic Acid; (R)-Cyclohexylhydroxyphenylacetic Acid |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.291 |
| Density | 1.206g/cm3 |
| Boiling Point | 408.579°C at 760 mmHg |
| Storage Condition | 2-8℃, dry |
| HTC | 2918199090 |
| PubChem ID | 8213288 |
| SMILES | O=C(O)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H18O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12,17H,2,5-6,9-10H2,(H,15,16)/t14-/m0/s1 |
| InChI Key | YTRNSQPXEDGWMR-AWEZNQCLSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| N-(5-(4-(hydroxymethyl)phenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl)cyclopropanecarboxamide | 1142936-49-9 | 2A-1183603 |
| N-(5-(4-formylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl)cyclopropanecarboxamide | 1206163-55-4 | 2A-1183604 |
| (R)-3,3,3-TRIFLUORO-2-HYDROXYPROPIONIC ACID | 121250-04-2 | 2A-3183620 |
| 2-Amino-4-(4-morpholinyl)benzonitrile | 28340-72-9 | 2A-3183625 |
| (S)-CYCLOHEXYL-HYDROXY-PHENYL-ACETIC ACID | 20585-34-6 | 2A-3183635 |
| (R)-ethyl 3-aminobutanoate hydrochloride | 146293-15-4 | 2A-1183662 |
| (1R,3R)-3-Aminocyclopentanol hydrochloride | 1523541-74-3 | 2A-1183673 |
| (1S,3S)3aMinocyclopentan1ol hydrochloride | 1523530-42-8 | 2A-1183674 |
| 5-chlorothiazolo[5,4-b]pyridine | 1313726-12-3 | 2A-1183683 |
| tert-butyl((3R,6S)-6-methylpiperidin-3-yl)carbamate | 1227917-63-6 | 2A-1183684 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA