
CAS Number4096-72-4
Synonyms2,6-Di-t-butyl-4-chlorophenol; 5-Chlor-2-hydroxy-1.3-di-tert.-butyl-benzol; 2,6-Di-tert-butyl-4-chlorophenol; 4-chloro-2,6-ditertiary butyl phenol; 2,6-Di-tert-butyl-4-chlor-phenol; 4-chloro-2,6-di-tert-butylphenol; Phenol,4-chloro-2,6-bis(1,1-dimethylethyl)
Molecular FormulaC14H21ClO
Molecular Weight240.776
Density1.032g/cm3
Boiling Point264.3ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4096-72-4 |
| Catalog No. | 2A-3183598 |
| Chinese Name | 2,6-二叔丁基-4-氯苯酚 |
| Synonyms | 2,6-Di-t-butyl-4-chlorophenol; 5-Chlor-2-hydroxy-1.3-di-tert.-butyl-benzol; 2,6-Di-tert-butyl-4-chlorophenol; 4-chloro-2,6-ditertiary butyl phenol; 2,6-Di-tert-butyl-4-chlor-phenol; 4-chloro-2,6-di-tert-butylphenol; Phenol,4-chloro-2,6-bis(1,1-dimethylethyl) |
| Molecular Formula | C14H21ClO |
| Molecular Weight | 240.776 |
| Density | 1.032g/cm3 |
| Boiling Point | 264.3ºC at 760mmHg |
| Storage Condition | 2-8°C |
| HTC | 2908199090 |
| PubChem ID | 587948 |
| MDL Number | MFCD00087733 |
| SMILES | CC(C)(C)c1cc(Cl)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C14H21ClO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,1-6H3 |
| InChI Key | WLQMYDWPKCQDPQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Bromo-1-methylnaphthalene | 86456-68-0 | 2A-3183591 |
| 7-BROMO-4,4-DIMETHYL-3,4-DIHYDRO-2H-NAPHTHALEN-1-ONE | 166978-46-7 | 2A-3183593 |
| (4-Chloronaphthalen-1-yl)hydrazine hydrochloride | 1187928-20-6 | 2A-3183596 |
| PHTHALANILLIC ACID | 4727-29-1 | 2A-3183579 |
| (-)-VERBENONE | 1196-01-6 | 2A-1183558 |
| 1-(1-Ethyl-1H-imidazol-5-yl)methanamine dihydrochloride | 1255717-13-5 | 2A-3183603 |
| Tafamidis Meglumine | 951395-08-7 | 2A-1183606 |
| 5-(2,2-diMethyl-4H-benzo[d][1,3]dioxin-6-yl)oxazolidin-2-one | 452340-96-4 | 2A-1183607 |
| 2-Oxazolidinone, 3-[6-[2-[(2,6-dichlorophenyl)Methoxy]ethoxy]hexyl]-5-(2,2-diMethyl-4H-1, 3-benzodioxin-6-yl)-, (5R)- | 503068-36-8 | 2A-1183608 |
| 2-nitro-9,10-dihydroacridine | 1200798-52-2 | 2A-3183608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA