CAS Number101327-84-8
Synonyms1-nitro-2-naphthalenecarboxaldehyde; 1-nitro-[2]naphthaldehyde; 1-nitronaphthalene-2-carboxaldehyde; MFCD03427164; 2-Naphthalenecarboxaldehyde,1-nitro; 1-nitro-2-naphthylaldehyde; 1-nitro-naphthalene-2-carbaldehyde
Molecular FormulaO2NC10H6CHO
Molecular Weight201.18
Density1.368g/cm3
Boiling Point384.6ºC at 760 mmHg
Melting Point109-110ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 101327-84-8 |
| Catalog No. | 2A-3183570 |
| Chinese Name | 1-硝基-2-萘醛 |
| Synonyms | 1-nitro-2-naphthalenecarboxaldehyde; 1-nitro-[2]naphthaldehyde; 1-nitronaphthalene-2-carboxaldehyde; MFCD03427164; 2-Naphthalenecarboxaldehyde,1-nitro; 1-nitro-2-naphthylaldehyde; 1-nitro-naphthalene-2-carbaldehyde |
| Molecular Formula | O2NC10H6CHO |
| Molecular Weight | 201.18 |
| Density | 1.368g/cm3 |
| Boiling Point | 384.6ºC at 760 mmHg |
| Melting Point | 109-110ºC(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2913000090 |
| PubChem ID | 24879478 |
| MDL Number | MFCD03427164 |
| SMILES | O=Cc1ccc2ccccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7NO3/c13-7-9-6-5-8-3-1-2-4-10(8)11(9)12(14)15/h1-7H |
| InChI Key | XQIMHJNMEFIADP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-bromo-2,3,5,6-tetrafluorobenzaldehyde | 108574-98-7 | 2A-1183500 |
| D-Mandelic acid hydrazide | 2A-3183545 | 2A-3183545 |
| L-Mandelic acid hydrazide | 2A-3183546 | 2A-3183546 |
| 8-chloronaphthalene-1-carboxylic acid | 4537-00-2 | 2A-3183565 |
| 3-Methoxynaphthalene-1-carboxylic acid | 147397-60-2 | 2A-3183568 |
| 1-Nitronaphthalene-2-carboxylic acid | 103987-83-3 | 2A-3183571 |
| 1-aminonaphthalene-2-carboxylic acid | 4919-43-1 | 2A-3183572 |
| 1-Naphthalenecarboxaldehyde, 4-nitro- | 42758-54-3 | 2A-3183581 |
| 1-Bromomethyl-4-methylnaphthalene | 41791-10-0 | 2A-3183587 |
| 5-Pyrimidinecarboxylic acid, hydrazide (6CI,7CI,9CI) | 40929-42-8 | 2A-3183601 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS