
CAS Number876-15-3
Synonyms4-Hydroxy-3.5-dimethyl-benzylamin; 2,6-DIMETHYL-4-CYANOPHENOL; 4-(aminomethyl)-2,6-dimethylphenol; 4-CYANO-2,6-DIMETHYLPHENOLE; 4-hydroxy-3,5-dimethyl-benzenecarbonitrile; 3,5-dimethyl-4-hydroxybenzenemethanamine; MFCD00221716; 4-CYANO-2,6-DIMETHYLPHENOL
Molecular FormulaC9H13NO
Molecular Weight155.1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 876-15-3 |
| Catalog No. | 2A-3183555 |
| Chinese Name | 4-(甲氨基)-2,6-二甲基苯酚 |
| Synonyms | 4-Hydroxy-3.5-dimethyl-benzylamin; 2,6-DIMETHYL-4-CYANOPHENOL; 4-(aminomethyl)-2,6-dimethylphenol; 4-CYANO-2,6-DIMETHYLPHENOLE; 4-hydroxy-3,5-dimethyl-benzenecarbonitrile; 3,5-dimethyl-4-hydroxybenzenemethanamine; MFCD00221716; 4-CYANO-2,6-DIMETHYLPHENOL |
| Molecular Formula | C9H13NO |
| Molecular Weight | 155.1 |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 39765176 |
| SMILES | Cc1cc(CN)cc(C)c1O |
| InChI | InChI=1S/C9H9NO/c1-6-3-8(5-10)4-7(2)9(6)11/h3-4,11H,1-2H3 |
| InChI Key | YZNPLEYSBNPOLB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| O-fluoromandelic acid | 2A-3183549 | 2A-3183549 |
| L-o-fluoromandelic acid | 2A-3183550 | 2A-3183550 |
| DL-4-HYDROXYMANDELIC ACID MONOHYDRATE | 7198-10-9 | 2A-3183551 |
| sodium 4-hydroxyphenylglycolate | 2A-3183552 | 2A-3183552 |
| sodium 4-hydroxyphenylglycolate | 69322-01-6 | 2A-3183553 |
| OLEANDOMYCIN PHOSPHATE | 7060-74-4 | 2A-1183556 |
| AT-101 | 866541-93-7 | 2A-3183559 |
| 6-Bromo-1-chloronaphthalene | 1000391-24-1 | 2A-3183562 |
| 1,8-DICHLORONAPHTHALENE | 2050-74-0 | 2A-3183563 |
| 1-Hydroxy-8-bromonaphthalene | 62456-32-0 | 2A-3183564 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA