![(E)-3-[[[3-[2-(7-CHLORO-2-QUINOLINYL)ETHENYL]PHENYL]-[[(3-DIMETHYLAMINO)-3-OXOPROPYL]THIO]METHYL]THIO]-PROPANOIC ACID, SODIUM SALT structure, CAS 115104-28-4](/structures/210000/184635_1_115104_28_4.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 115104-28-4 |
| Catalog No. | 2A-3183459 |
| Chinese Name | MK 571钠盐(L 660711钠盐) |
| Synonyms | mk-571,na salt; mk-571 sodium salt |
| Molecular Formula | C26H27ClN2O3S2 |
| Molecular Weight | 537.07 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 712.3±60.0 °C at 760 mmHg |
| Appearance | white to beige powder |
| Storage Condition | 20°C |
| Application | MK-571 (L-660711) is an orally active, selective, and competitive leukotriene D4 (LTD4) receptor antagonist with Ki values of 0.22 and 2.1 nM in guinea pig and human lung membranes, respectively. MK |
| PubChem ID | 13418 |
| MDL Number | MFCD00797675 |
| SMILES | CN(C)C(=O)CCSC(SCCC(=O)O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C26H27ClN2O3S2/c1-29(2)24(30)12-14-33-26(34-15-13-25(31)32)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(27)17-23(19)28-22/h3-11,16-17,26H,12-15H2,1-2H3,(H,31,32)/b10-6+ |
| InChI Key | AXUZQJFHDNNPFG-UXBLZVDNSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352211 |
| Transport Info | Product name: MK 571 sodium salt (L 660711 sodium salt) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4,6-Diphenyl-1,3,5-triazin-2-yl)phenol | 7753-02-8 | 2A-3183444 |
| 9,10-DibromoPhenanthrene | 15810-15-8 | 2A-3183452 |
| N-[1,1-biphenyl]-4-yl-N-phenyl-[1,1-Biphenyl]-4-amine | 122215-84-3 | 2A-3183453 |
| 3'',1''']quaterphenyl | 106785-63-1 | 2A-3183454 |
| 3-chloro-1,1':3',1''-terphenyl | 98781-25-0 | 2A-3183455 |
| Icotinib (Hydrochloride) | 1204313-51-8 | 2A-3183461 |
| Endoxifen | 112093-28-4 | 2A-3183462 |
| PNU 100480 | 168828-58-8 | 2A-3183464 |
| BMS 833923 | 1059734-66-5 | 2A-3183465 |
| FPH2 | 957485-64-2 | 2A-3183466 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA