
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85233-15-4 |
| Catalog No. | 2A-1183344 |
| Chinese Name | 4-氟-2-碘-5-甲基苯胺 |
| Synonyms | Benzenamine,4-fluoro-2-iodo-5-methyl; 4-Fluoro-2-iodo-5-methylaniline; 5-Amino-4-iodo-2-fluorotoluene |
| Molecular Formula | C7H7FIN |
| Molecular Weight | 251.04 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 264.1±40.0 °C at 760 mmHg |
| Appearance | white to yellow solid |
| Storage Condition | 2-8°C, protected from light, inert gas |
| HTC | 2921430090 |
| PubChem ID | 56405132 |
| SMILES | Cc1cc(N)c(I)cc1F |
| InChI | InChI=1S/C7H7FIN/c1-4-2-7(10)6(9)3-5(4)8/h2-3H,10H2,1H3 |
| InChI Key | HYRIJSOXIOVDKF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 4-methylcyclohexane-1,3-diamine | 13897-55-7 | 2A-3183034 |
| Ethanol, 2-[4-[2-(2-hydroxyethoxy)ethoxy]phenoxy]- | 849677-06-1 | 2A-3183036 |
| PHOSPHATIDYLETHANOLAMINE | 39382-08-6 | 2A-4183194 |
| [1S,2S,(-)]-1,2-Cyclohexanedimethanol | 3205-34-3 | 2A-3183300 |
| 2,6-Dibromo-4-Fluorotoluene | 906649-94-3 | 2A-1183339 |
| 2-(PENTAFLUOROPHENYL)ETHANOL | 653-31-6 | 2A-1183499 |
| Mono-6-O-(p-toluenesulfonyl)-beta-cyclodextrin | 67217-55-4 | 2A-1183518 |
| (8-BROMO-1-NAPHTHYL)METHANOL | 14938-58-0 | 2A-3183592 |
| N,N,N',N'-TETRABUTYL-1,6-HEXANEDIAMINE | 27090-63-7 | 2A-3183600 |
| (1R)-2-[[6-[2-[(2,6-Dichlorobenzyl)oxy]ethoxy]hexyl]aMino]-1-(2,2-diMethyl-4H-1,3-benzodioxin-6-yl)ethanol | 503068-37-9 | 2A-1183609 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA