
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34006-49-0 |
| Catalog No. | 2A-1183255 |
| Chinese Name | 2-氯-1-(4-硝基苯基)乙基-1-酮 |
| Synonyms | 4-nitrophenacyl chloride; 4-nitrophenyl chloromethyl ketone |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 138.55 |
| Density | 1.384g/cm3 |
| Boiling Point | 322.1ºC at 760mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 24879022 |
| MDL Number | MFCD00174318 |
| SMILES | O=C(CCl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H6ClNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| InChI Key | YKLMHYUFNDAZAG-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-lauroyl-2-oleoyl -sn-glycero-3-phosphocholine | 91917-72-5 | 2A-1183243 |
| 1-lauroyl-2-stearoyl -sn-glycero-3-phosphocholine | 127912-48-5 | 2A-1183244 |
| 1-lauroyl-2-palmitoyl -sn-glycero-3-phosphocholine | 127641-76-3 | 2A-1183245 |
| 1-lauroyl-2-myristoyl -sn-glycero-3-phosphocholine | 127702-66-3 | 2A-1183246 |
| α-Chloro-3'-nitroacetophenone | 99-47-8 | 2A-1183254 |
| N,N-Bis(4-sulfobutyl)-3-methylaniline,disodiumsalt | 127544-88-1 | 2A-3183257 |
| (E)-3-(2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)prop-2-en-1-ol | 1623109-08-9 | 2A-3183264 |
| Ethyl (E)-3,5-dihydroxy-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolinyl]-hept-6-enoate | 477950-34-8 | 2A-3183265 |
| Aliskiren hemifumarate | 173334-58-2 | 2A-3183267 |
| 3-(2,2,2-Trimethylhydrazine)methylpropionate bromide | 106966-65-8 | 2A-3183269 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA