
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-48-9 |
| Catalog No. | 2A-1183128 |
| Chinese Name | 二乙基甲苯 |
| Synonyms | N,N-diethyl-4-methylaniline; EINECS 210-345-0; MFCD00015113 |
| Molecular Formula | 4-(CH3)C6H4N(CH3)2 |
| Molecular Weight | 135.21 |
| Density | 0.92 |
| Boiling Point | 103 °C (10 mmHg) |
| Appearance | colorless liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2921430090 |
| PubChem ID | 74327 |
| MDL Number | MFCD00008316 |
| SMILES | CCN(CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-8-6-10(3)7-9-11/h6-9H,4-5H2,1-3H3 |
| InChI Key | HKJNHYJTVPWVGV-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352116 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Meldrum's Acid | 33-24-1 | 2A-3183119 |
| H-VAL-BETANA | 729-24-8 | 2A-4183122 |
| NN-dihydroxyethyl m-toluidine | 2A-1183124 | 2A-1183124 |
| N-Methyl-N-hydroxyethyl-m-methylaniline | 2A-1183125 | 2A-1183125 |
| N-(2-HYDROXYETHYL)-N-METHYL-4-TOLUIDINE | 2842-44-6 | 2A-1183126 |
| N-METHYL-O-TOLUIDINE | 611-21-2 | 2A-1183129 |
| Red Yeast Rice Powder | 39866-30-2 | 2A-3183132 |
| 1,2-NAPHTHOXY-DIAZOLE-4-SULFONIC ACID | 4857-47-0 | 2A-1183133 |
| 2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane | 129228-11-1 | 2A-4183135 |
| azasetron | 123040-93-7 | 2A-1183136 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA