
CAS Number23313-12-4
SynonymsAscorbate-2-phosphate; 2-phospho-L-ascorbic acid; 2-O-phosphonohex-1-enofuranos-3-ulose; L-Ascorbate 2-monophosphate; ascorbic acid-2-phosphoric acid ester; L-ascorbic acid 2-O-phosphate; ascorbic acid 2-phosphate
Molecular FormulaC6H9O9P
Molecular Weight256.11
Density2.01 g/cm3
Boiling Point561.3ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23313-12-4 |
| Catalog No. | 2A-1182998 |
| Chinese Name | 维生素C磷酸酯 |
| Synonyms | Ascorbate-2-phosphate; 2-phospho-L-ascorbic acid; 2-O-phosphonohex-1-enofuranos-3-ulose; L-Ascorbate 2-monophosphate; ascorbic acid-2-phosphoric acid ester; L-ascorbic acid 2-O-phosphate; ascorbic acid 2-phosphate |
| Molecular Formula | C6H9O9P |
| Molecular Weight | 256.11 |
| Density | 2.01 g/cm3 |
| Boiling Point | 561.3ºC at 760 mmHg |
| Storage Condition | room temperature |
| Application | L-ascorbic acid 2-phosphate is a long-acting vitamin C derivative that stimulates collagen expression and formation. L-ascorbic acid 2-phosphate can be used as a culture medium to supplement the osteo |
| PubChem ID | 3155103 |
| MDL Number | C6H9O9P |
| SMILES | O=C1OC(C(O)CO)C(O)=C1OP(=O)(O)O |
| InChI | InChI=1S/C6H9O9P/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13/h2,4,7-8,10H,1H2,(H2,11,12,13)/t2-,4+/m0/s1 |
| InChI Key | MIJPAVRNWPDMOR-ZAFYKAAXSA-N |
| Transport Info | Product name: L-ascorbic acid-2-monophosphate tricyclohexyl ammonium salt |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| Rs-300PolyoxyethyleneOleylCetylEtherSulfosuccinate | 68920-66-1 | 2A-4182580 |
| N-(2-hydroxyethyl)-N-[2-[(1-oxooctyl)amino]ethyl]-beta-alanine | 64265-45-8 | 2A-4182584 |
| N-NITROSO-N-PHENYL-GLYCINE ANILIDE | 855931-91-8 | 2A-1182724 |
| VITAMIN D3 | 511-28-4 | 2A-3182801 |
| Ubrogepant | 1374248-77-7 | 2A-1182810 |
| FRUCTOOLIGOSACCHARIDES | 308066-66-2 | 2A-1183000 |
| Vitamin E | 121854-78-2 | 2A-1183017 |
| DOCOSAHEXAENOIC ACID | 25167-62-8 | 2A-1183018 |
| 3'-prenylnaringenin | 119240-82-3 | 2A-1183027 |
| CHONDROITIN SULFATE SODIUM | 2A-3183082 | 2A-3183082 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA