
CAS Number1469924-27-3
Synonyms3-[4'-(Dimethylamino)-3-biphenylyl]-1,1-dimethylurea; 3-[4-(Dimethylamino)-3-biphenylyl]-1,1-dimethylurea; Atglistatin
Molecular FormulaC17H21N3O
Molecular Weight283.37
Density1.1±0.1 g/cm3
Boiling Point484.4±45.0 °C at 760 mmHg
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1469924-27-3 |
| Catalog No. | 2A-1182951 |
| Chinese Name | Atglistatin |
| Synonyms | 3-[4'-(Dimethylamino)-3-biphenylyl]-1,1-dimethylurea; 3-[4-(Dimethylamino)-3-biphenylyl]-1,1-dimethylurea; Atglistatin |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 484.4±45.0 °C at 760 mmHg |
| Appearance | white solid |
| Storage Condition | -20℃ |
| Application | Atglistatin is a selective adipose triglyceride lipase (ATGL) inhibitor that inhibits lipolysis in vitro with an IC50 of 0.7 μM. |
| PubChem ID | 85426466 |
| SMILES | CN(C)C(=O)Nc1cccc(-c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C17H21N3O/c1-19(2)16-10-8-13(9-11-16)14-6-5-7-15(12-14)18-17(21)20(3)4/h5-12H,1-4H3,(H,18,21) |
| InChI Key | AWOPBSAJHCUSAS-UHFFFAOYSA-N |
| Transport Info | Product name: Atglistatin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-chloro-N-ethyl-4-methyl-4-phenyl-4H-3,1-benzoxazin-2-amine monohydrochloride | 56776-32-0 | 2A-1182943 |
| AD80 | 1384071-99-1 | 2A-1182946 |
| AFN-1252 | 620175-39-5 | 2A-1182948 |
| AKT inhibitor 2 | 1313881-70-7 | 2A-1182950 |
| Cefalonium | 2A-3182947 | 2A-3182947 |
| AUZ 454 | 853299-07-7 | 2A-1182952 |
| AZ 628 | 878739-06-1 | 2A-1182953 |
| AZD-5069 | 878385-84-3 | 2A-1182954 |
| AZD-7594 | 1196509-60-0 | 2A-1182955 |
| BAM7 | 331244-89-4 | 2A-1182956 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA