
CAS Number18342-97-7
Synonyms3-HYDROXYPYRIDINE-4-CARBOXYLIC ACID ETHYL ESTER; 5-hydroxyisonicotinic acid ethyl ester; 3-hydroxy-isonicotinic acid ethyl ester; 3-Hydroxy-pyridin-4-carbonsaeureethylester; ethyl-3-hydroxyisonicotinate; 4-(Ethoxycarbonyl)-3-hydroxypyridine; QC-721
Molecular FormulaC8H9NO3
Molecular Weight167.16
Purity98.00%
Density1.233g/cm3
Boiling Point321.943 °C at 760 mmHg
AppearanceLight yellow to yellowish brown solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18342-97-7 |
| Catalog No. | 2A-1182764 |
| Chinese Name | 3-羟基吡啶-4-羧酸乙酯 |
| Synonyms | 3-HYDROXYPYRIDINE-4-CARBOXYLIC ACID ETHYL ESTER; 5-hydroxyisonicotinic acid ethyl ester; 3-hydroxy-isonicotinic acid ethyl ester; 3-Hydroxy-pyridin-4-carbonsaeureethylester; ethyl-3-hydroxyisonicotinate; 4-(Ethoxycarbonyl)-3-hydroxypyridine; QC-721 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 |
| Purity | 98.00 |
| Density | 1.233g/cm3 |
| Boiling Point | 321.943 °C at 760 mmHg |
| Appearance | Light yellow to yellowish brown solid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2933399090 |
| PubChem ID | 42671602 |
| SMILES | CCOC(=O)c1ccncc1O |
| InChI | InChI=1S/C8H9NO3/c1-2-12-8(11)6-3-4-9-5-7(6)10/h3-5,10H,2H2,1H3 |
| InChI Key | XIBQCRQYVCFUFO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| N-Nitroso 1-(2-methoxyphenyl)piperazine | 2A-2182742 | 2A-2182742 |
| 5,7-dichloro-2-nitroso-1,2,3,4-tetrahydroisoquinoline | 2A-2182745 | 2A-2182745 |
| 3,6-dichloropyrazine-2-carbonitrile | 356783-16-9 | 2A-1182759 |
| 6-Fluoro-3-hydroxypyrazine-2-carbonitrile | 356783-31-8 | 2A-1182760 |
| 6-Fluoro-3-hydroxypyrazine-2-carboxylicacid | 1079990-21-8 | 2A-1182761 |
| 4a,5,9,10,11,12-Hexahydro-1-bromo-3-methoxy-11-formyl- 6H-Benzofuro[3a,3,2-ef][2] benzazepine-6-one | 122584-14-9 | 2A-3182771 |
| 4-(2-FLUOROPHENYL)-1H-PYRROLE-3-CARBONITRILE | 103418-03-7 | 2A-1182799 |
| 1-chloro-3,5-di-oxo-p-toluoyl-2-deoxy-L-ribofuranose | 2A-3182817 | 2A-3182817 |
| (4R-cis)-6-Chloromethyl-2,2-dimethyl-1,3-dioxane-4-acetic Acid tert-Butyl Ester | 154026-94-5 | 2A-3182832 |
| 3.5dibromo-1H-pyrazole | 67460-86-0 | 2A-1182841 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA