
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4143-63-9 |
| Catalog No. | 2A-3182666 |
| Chinese Name | 4'-羟基黄酮 |
| Synonyms | 4'-monohydroxyflavone; Flavone,4'-hydroxy; 4'-hydroxy flavone |
| Molecular Formula | C15H10O3 |
| Molecular Weight | 238.24 |
| Density | 1.34g/cm3 |
| Boiling Point | 425.8ºC at 760mmHg |
| Melting Point | 275 °C |
| Appearance | Solid;Light yellow to Brown powder to crystal |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2914501900 |
| MDL Number | MFCD00017687 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2ccccc12 |
| InChI | InChI=1S/C15H10O3/c16-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-9,16H |
| InChI Key | SHGLJXBLXNNCTE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2914501900 other ketone-phenols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Glu-di-tosyl (Intermediates) | 2A-3182658 | 2A-3182658 |
| 1-(2-Hydroxy ethoxy )propan-2-one | 2A-3182659 | 2A-3182659 |
| 2-(6-Hydroxy naphthalen-2yl)-Propionic acid methyl ester | 61495-42-9 | 2A-3182660 |
| 2'-Hydroxy-5'-methyl propiophenone | 2A-3182662 | 2A-3182662 |
| 4'-Hydroxy-5,7-Dimethoxy flavone | 2A-3182663 | 2A-3182663 |
| 2'-Hydroxy-2-phenyl acetophenoe | 2491-31-8 | 2A-3182667 |
| 4-Hydroxy-4-methoxy tolane | 2A-3182668 | 2A-3182668 |
| 2'-Hydroxy-4'-methyl propiophenone | 15482-26-5 | 2A-3182673 |
| 6-(2-Chloroacetyl)benzo[d]thiazol-2(3H)-one | 99615-55-1 | 2A-2182679 |
| Benzyl (4-broMo-3-fluorophenyl)carbaMate | 510729-01-8 | 2A-2182680 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA