
CAS Number3538-68-9
Synonyms3-Phenyl-propionic acid hydrazide; dihydrocinnamic acid hydrazide; 3-phenylpropionyl hydrazide; 3-phenylpropanohydrazide; 3-phenylpropanoylhydrazine; benzenepropanoic acid,hydrazide
Molecular FormulaC9H12N2O
Molecular Weight164.21
Density1.106g/cm3
Boiling Point373.8ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3538-68-9 |
| Catalog No. | 2A-1182641 |
| Chinese Name | 3-苯基丙酰肼 |
| Synonyms | 3-Phenyl-propionic acid hydrazide; dihydrocinnamic acid hydrazide; 3-phenylpropionyl hydrazide; 3-phenylpropanohydrazide; 3-phenylpropanoylhydrazine; benzenepropanoic acid,hydrazide |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 |
| Density | 1.106g/cm3 |
| Boiling Point | 373.8ºC at 760mmHg |
| Storage Condition | 2-8°C, store away from light, dry and sealed |
| HTC | 2928000090 |
| PubChem ID | 112159 |
| SMILES | NNC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C9H12N2O/c10-11-9(12)7-6-8-4-2-1-3-5-8/h1-5H,6-7,10H2,(H,11,12) |
| InChI Key | LSSUJBFVEXWEEC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-ETHOXYBENZHYDRAZIDE | 27830-16-6 | 2A-1182630 |
| 3-PHENOXYBENZHYDRAZIDE | 206761-84-4 | 2A-1182631 |
| 2-PHENOXYBENZHYDRAZIDE | 43038-37-5 | 2A-1182632 |
| 2-(p-Bromophenyl)acetyl hydrazide | 14579-97-6 | 2A-1182639 |
| 4-(DIETHYLAMINO)BENZHYDRAZIDE | 100139-54-6 | 2A-1182640 |
| (2,6-dimethoxy-4-methylphenyl)boronic acid(SALTDATA: FREE) | 176528-19-1 | 2A-4182689 |
| 1,2,3-Cyclopropanetricarboxylic acid, triethyl ester | 729-87-3 | 2A-4182698 |
| 2-(METHYLDITHIO)-ISOBUTYRALDEHYDE | 67952-60-7 | 2A-4182703 |
| 6-ISOPROPOXY-9-XANTHONE-2-CARBOXYLIC ACID | 33458-93-4 | 2A-1182749 |
| 2-PICOLINE-3-BORONIC ACID HCL | 1072952-34-1 | 2A-1182840 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA