
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22631-60-3 |
| Catalog No. | 2A-1182524 |
| Chinese Name | 2-(2-氯苯基)乙酰肼 |
| Synonyms | (2-chlorophenyl)acetic acid hydrazide; 2-(1`,2`,3`,4`-TETRAHYDROXYBUTYL)QUINOXALINE; o-chlorophenylacetylhydrazine; o-Chlorphenylacetylhydrazid |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.62 |
| Density | 1.283g/cm3 |
| Boiling Point | 394.9ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2942000000 |
| PubChem ID | 3151631 |
| SMILES | NNC(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C8H9ClN2O/c9-7-4-2-1-3-6(7)5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| InChI Key | WSKCRBSHOIAZBQ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Bromo-2,5-dimethoxybenzaldehyde | 31558-41-5 | 2A-1182515 |
| PYRIDINE-2-CARBOXYLIC ACID HYDRAZIDE | 1452-63-7 | 2A-1182518 |
| SEBACIC DIHYDRAZIDE | 925-83-7 | 2A-1182519 |
| 2-PHENOXYACETOHYDRAZIDE | 4664-55-5 | 2A-1182522 |
| 6-AMINONICOTINOHYDRAZIDE | 42596-56-5 | 2A-1182523 |
| (4-HYDROXY-PHENYL)-ACETIC ACID HYDRAZIDE | 20277-02-5 | 2A-1182526 |
| (4-CHLORO-PHENOXY)-ACETIC ACID HYDRAZIDE | 2381-75-1 | 2A-1182562 |
| 4-IODOBENZHYDRAZIDE | 39115-95-2 | 2A-1182563 |
| CBZ-GLY HYDRAZIDE | 5680-83-1 | 2A-1182564 |
| 1,2-Benzenedicarboxylic acid dihydrazide | 3645-45-2 | 2A-1182565 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA