
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70680-93-2 |
| Catalog No. | 2A-1182414 |
| Chinese Name | 3-氯-l-酪氨酸 |
| Synonyms | 3-Chlorotyrosine; L-Tyrosine,2-chloro |
| Molecular Formula | 4-(HO)C6H3(Cl)CH2CH(NH2)CO2H |
| Molecular Weight | 215.63 |
| Purity | 98.00 |
| Melting Point | 249 ℃(lit.) |
| EINECS | 231-050-3 |
| HTC | 2922509090 |
| PubChem ID | 24873634 |
| MDL Number | MFCD00045865 |
| SMILES | NC(Cc1ccc(O)cc1Cl)C(=O)O |
| InChI | InChI=1S/C9H10ClNO3/c10-7-4-6(12)2-1-5(7)3-8(11)9(13)14/h1-2,4,8,12H,3,11H2,(H,13,14)/t8-/m0/s1 |
| InChI Key | QGFVUADZXXJSDI-QMMMGPOBSA-N |
| NACRES Code | NA.22 |
| eCl@ss | 32160406 |
| UNSPSC | 12352209 |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| Lactobacillus Casei 300B | 2A-3182387 | 2A-3182387 |
| Lactobacillus Gasseri | 2A-3182388 | 2A-3182388 |
| Lactobacillus Plantarum | 2A-3182389 | 2A-3182389 |
| Lactobacillus Rhamnosus | 2A-3182390 | 2A-3182390 |
| Lactobacillus Salivarius | 2A-3182391 | 2A-3182391 |
| Rs-300PolyoxyethyleneOleylCetylEtherSulfosuccinate | 68920-66-1 | 2A-4182580 |
| N-(2-hydroxyethyl)-N-[2-[(1-oxooctyl)amino]ethyl]-beta-alanine | 64265-45-8 | 2A-4182584 |
| N-NITROSO-N-PHENYL-GLYCINE ANILIDE | 855931-91-8 | 2A-1182724 |
| VITAMIN D3 | 511-28-4 | 2A-3182801 |
| Ubrogepant | 1374248-77-7 | 2A-1182810 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA