
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90110-32-0 |
| Catalog No. | 2A-3182503 |
| Chinese Name | 1-(5-氯-2,4-二羟基苯基)乙酮 |
| Synonyms | 1-(5-Chlor-2,4-dihydroxy-phenyl)-aethanon; 1-(5-chloro-2,4-dihydroxy-phenyl)-ethanone; Ethanone,1-(5-chloro-2,4-dihydroxyphenyl) |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59200 |
| Melting Point | 175-177ºC |
| HTC | 2914700090 |
| PubChem ID | 29549610 |
| SMILES | CC(=O)c1cc(Cl)c(O)cc1O |
| InChI | InChI=1S/C8H7ClO3/c1-4(10)5-2-6(9)8(12)3-7(5)11/h2-3,11-12H,1H3 |
| InChI Key | CVJQCEUAIVQCDK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2',4'-Benzyl -3'-methoxy acetophenone | 2A-3182491 | 2A-3182491 |
| 6-Bromo-4-chromone | 2A-3182497 | 2A-3182497 |
| 8-Bromo-6-chloro-3-formylchromone | 2A-3182498 | 2A-3182498 |
| 3-Bromo-5-chloro-2-hydroxy benzophenone | 85346-47-0 | 2A-3182499 |
| 5'-Bromo-3'-chloro-2'-hydroxypropiophenone | 2A-3182500 | 2A-3182500 |
| 2-(2-Chlorophenyl)-7-ethoxy-4H-chromen-4-one | 2A-3182506 | 2A-3182506 |
| 3-Cyano-6-chloro-7-methyl chromone | 2A-3182507 | 2A-3182507 |
| butyl 3-hydroxybutyrate | 53605-94-0 | 2A-1182516 |
| ETHYL MANDELATE | 774-40-3 | 2A-1182517 |
| ISOPROPYL BENZOATE | 939-48-0 | 2A-1182520 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA